![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | Договір оферти.pdf | 2024-04-19 18:34 | 66K | |
![[ ]](/icons/layout.gif) | Инструкция по эксплуатации PicoCell 900SXB+, 1800SXB+, 2000SXB+.pdf | 2019-03-19 15:00 | 2.1M | |
![[ ]](/icons/layout.gif) | Инструкция по эксплуатации PicoCell E900|1800SXB+, E900|2000SXB+, 1800|2000SXB+.pdf | 2019-03-19 15:04 | 2.2M | |
![[ ]](/icons/unknown.gif) | ПО_iRZ_Collector_(диспетчерская + серверная часть) 32- и 64-битная версия.rar | 2019-09-12 10:17 | 46M | |
![[ ]](/icons/compressed.gif) | Программа для тестирования модемов, версия 32-bit.zip | 2019-03-20 17:16 | 29M | |
![[ ]](/icons/compressed.gif) | Программа для тестирования модемов, версия 64-bit.zip | 2019-03-20 17:16 | 30M | |
![[ ]](/icons/unknown.gif) | Прошивка atm21_1.4-024.254_11.01.19.rar | 2019-03-21 17:53 | 100K | |
![[ ]](/icons/layout.gif) | Руководство по работе с программой настройки Script Loader.pdf | 2019-03-20 17:23 | 391K | |
![[ ]](/icons/layout.gif) | ТАУ 902 техническое описание.pdf | 2019-04-17 23:52 | 321K | |
![[ ]](/icons/layout.gif) | ТАУ 918 техническое описание.pdf | 2019-04-17 23:57 | 296K | |
![[ ]](/icons/layout.gif) | ТАУ 2000 техническое описание.pdf | 2019-04-18 00:07 | 729K | |
![[ ]](/icons/layout.gif) | Техническое описание антенны А6 Aqueduct.pdf | 2019-03-19 14:43 | 184K | |
![[ ]](/icons/layout.gif) | 00658-MeP-EFB7-Direct-Burial-1-All-ENpAll1-EN.pdf | 2023-05-30 21:40 | 130K | |
![[ ]](/icons/layout.gif) | 1-2S-E-LSZH-41010300013.pdf | 2025-02-15 23:24 | 216K | |
![[ ]](/icons/layout.gif) | 2-way-Splitter-575-6000MHz-150dBc-N-maniron.pdf | 2025-08-29 01:14 | 228K | |
![[ ]](/icons/layout.gif) | 3.01.166-SMA-Jack-End -Launch-for-PCB-Edge-Mount-Installation-Size-1.73-mm.pdf | 2025-08-10 01:12 | 203K | |
![[ ]](/icons/layout.gif) | 3.01.281-SMA-PLUG-FOR-RG402-CABLE.pdf | 2025-05-12 23:40 | 209K | |
![[ ]](/icons/layout.gif) | 3.01.282-SMA-PLUG-FOR-RG58-RG223-RG142-RG400-CABLE.pdf | 2025-07-14 00:12 | 213K | |
![[ ]](/icons/layout.gif) | 3.01.283-RP-SMA-JACK-FOR-RG58_RG223-CABLE.pdf | 2025-08-02 23:55 | 271K | |
![[ ]](/icons/layout.gif) | 3.01.288-SMA-RA-PLUG-FOR-RG402-CABLE.pdf | 2025-08-08 23:35 | 205K | |
![[ ]](/icons/layout.gif) | 3.01.289-SMA-PLUG-FOR-RG405-CABLE.pdf | 2025-08-12 12:52 | 1.6M | |
![[ ]](/icons/layout.gif) | 3.01.298-SMA-PLUG-FOR-RG316-CABLE.pdf | 2025-06-11 00:25 | 212K | |
![[ ]](/icons/layout.gif) | 3.01.300-SMA-PLUG-FOR-LMR240-CABLE.pdf | 2025-07-15 21:23 | 213K | |
![[ ]](/icons/layout.gif) | 3.01.301-RP-SMA-PLUG-FOR-RG58-RG223-CABLE-V.2.pdf | 2025-08-22 00:21 | 415K | |
![[ ]](/icons/layout.gif) | 3.01.302-SMA-JACK-FOR-LMR240-CABLE.pdf | 2025-07-24 00:05 | 213K | |
![[ ]](/icons/layout.gif) | 3.01.303-SMA-RA-PLUG-FOR-RG316-CABLE.pdf | 2025-08-08 23:50 | 208K | |
![[ ]](/icons/layout.gif) | 3.01.305-SMA-JACK-FOR-RG223-CABLE.pdf | 2025-08-03 13:36 | 212K | |
![[ ]](/icons/layout.gif) | 3.01.332-SMA-PLUG-FOR-RG8-CABLE.pdf | 2025-03-05 00:31 | 268K | |
![[ ]](/icons/layout.gif) | 3.01.334-SMA-PLUG-FOR-LMR300-CABLE.pdf | 2025-08-06 23:31 | 212K | |
![[ ]](/icons/layout.gif) | 3.01.336-SMA-PLUG-FOR-250-SEMIFLEX-CABLE.pdf | 2025-02-02 23:32 | 207K | |
![[ ]](/icons/layout.gif) | 3.01.343-SMA-RA-PLUG-FOR-LMR240-CABLE-6G.pdf | 2025-08-21 15:54 | 3.0M | |
![[ ]](/icons/layout.gif) | 3.01.344-RP-SMA-PLUG-FOR-LMR400-CABLE.pdf | 2025-08-14 23:00 | 271K | |
![[ ]](/icons/layout.gif) | 3.01.368-SMA-PLUG-CAP.pdf | 2025-07-18 01:07 | 218K | |
![[ ]](/icons/layout.gif) | 3.01.369-RP-SMA-PLUG-FOR-RG316-CABLE.pdf | 2025-07-25 23:56 | 236K | |
![[ ]](/icons/layout.gif) | 3.01.370-SMA-JACK-BULKHEAD-FOR-141-CABLE.pdf | 2025-07-14 17:19 | 212K | |
![[ ]](/icons/layout.gif) | 3.01.379-RP-SMA-PLUG-FOR-RG405CABLE.pdf | 2025-08-14 22:44 | 2.4M | |
![[ ]](/icons/layout.gif) | 3.01.380-RP-SMA-PLUG-FOR-LMR300-CABLE.pdf | 2025-08-13 19:44 | 212K | |
![[ ]](/icons/layout.gif) | 3.01.381-RP-SMA-PLUG-FOR-LMR240-CABLE.pdf | 2025-08-14 23:26 | 211K | |
![[ ]](/icons/layout.gif) | 3.01.382#RP-SMA-PLUG-FOR-RG141CABLE.pdf | 2025-08-15 12:24 | 314K | |
![[ ]](/icons/layout.gif) | 3.01.382-RP-SMA-PLUG-FOR-RG141CABLE.pdf | 2025-09-16 16:09 | 314K | |
![[ ]](/icons/layout.gif) | 3.01.383-RP-SMA-JACK-BULKHEAD-FOR-141-CABLE.pdf | 2025-08-22 01:27 | 2.8M | |
![[ ]](/icons/layout.gif) | 3.01.384-RP-SMA-Female-Straight-Bulkhead-Crimp-for-RG316.pdf | 2025-08-15 00:28 | 2.9M | |
![[ ]](/icons/layout.gif) | 3.01.385-RP-SMA-Female-Straight-Bulkhead-Crimp-for-LMR240-.pdf | 2025-08-15 22:39 | 3.0M | |
![[ ]](/icons/layout.gif) | 3.01.386#RP-SMA-Female-Straight-Bulkhead-Crimp-for-LMR300.pdf | 2025-08-15 23:08 | 216K | |
![[ ]](/icons/layout.gif) | 3.01.386#RP-SMA Female Straight Bulkhead Crimp for LMR300.pdf | 2025-08-15 23:01 | 216K | |
![[ ]](/icons/layout.gif) | 3.01.386-RP-SMA-Female-Straight-Bulkhead-Crimp-for-LMR300.pdf | 2025-09-28 13:46 | 216K | |
![[ ]](/icons/layout.gif) | 3.01.389-RP-SMA-RA-PLUG-FOR-RG316-CABLE.pdf | 2025-08-15 00:04 | 208K | |
![[ ]](/icons/layout.gif) | 3.01.390-SMA-Female-Straight-Bulkhead-Crimp-for-LMR240.pdf | 2025-08-13 22:43 | 213K | |
![[ ]](/icons/layout.gif) | 3.01.391-SMA-Female-Straight-Bulkhead-Crimp-for-LMR300.pdf | 2025-08-13 22:22 | 216K | |
![[ ]](/icons/layout.gif) | 3.01.393-SMA-Female-Straight-Bulkhead-Crimp-for-RG58-RG223.pdf | 2025-08-13 22:06 | 213K | |
![[ ]](/icons/layout.gif) | 3.01.395-SMA-JACK-FLANGE-MOUNTING-JOINT-4HF.pdf | 2025-08-10 00:28 | 225K | |
![[ ]](/icons/layout.gif) | 3.01.396-SMA-Female-Straight-Bulkhead-Crimp-for-RG316.pdf | 2025-08-13 22:59 | 213K | |
![[ ]](/icons/layout.gif) | 3.01.400-SMA-JACK-FLANGE-MOUNTING-JOINT-4HF.pdf | 2025-11-09 20:53 | 315K | |
![[ ]](/icons/layout.gif) | 3.01.401-SMA-JACK-BULKHEAD-FOR-086-CABLE.pdf | 2025-11-13 23:37 | 308K | |
![[ ]](/icons/layout.gif) | 3.01.402-RP-SMA-JACK-BULKHEAD-FOR-086-CABLE.pdf | 2025-11-14 01:39 | 308K | |
![[ ]](/icons/layout.gif) | 3.01.403-SMA-RA-PLUG-FOR-250-CABLE.pdf | 2025-11-13 01:23 | 299K | |
![[ ]](/icons/layout.gif) | 3.02.049-TNC-JACK-FOR-RG316.pdf | 2025-09-28 19:16 | 213K | |
![[ ]](/icons/layout.gif) | 3.02.082-TNC-PLUG-FOR-RG58-RG223-CABLE.pdf | 2025-06-15 20:42 | 211K | |
![[ ]](/icons/layout.gif) | 3.02.090-TNC-PLUG-CRIMP-FOR-LMR400-CABLE.pdf | 2025-08-30 23:07 | 321K | |
![[ ]](/icons/layout.gif) | 3.04.0147-N-0RA-PLUG-FOR-LMR400-UF-CABLE.pdf | 2025-07-13 11:58 | 180K | |
![[ ]](/icons/layout.gif) | 3.04.0255-N-PLUG-FOR-RG58-CABLE.pdf | 2025-07-19 23:02 | 214K | |
![[ ]](/icons/layout.gif) | 3.04.0256-N-JACK-FOR-RG58-RG223-RG142-RG400-CABLE.pdf | 2025-07-14 11:53 | 213K | |
![[ ]](/icons/layout.gif) | 3.04.0259-N-PLUG-SOLDER-FOR-RG402-CABLE.pdf | 2025-06-07 23:31 | 253K | |
![[ ]](/icons/layout.gif) | 3.04.0264-N-PLUG-FOR-LMR240-CABLE.pdf | 2025-06-10 00:18 | 212K | |
![[ ]](/icons/layout.gif) | 3.04.0266-N-RA-PLUG-FOR-RG141-CABLE.pdf | 2025-05-12 23:59 | 207K | |
![[ ]](/icons/layout.gif) | 3.04.0267-N-JACK-DUST-CAP.pdf | 2025-06-14 20:32 | 238K | |
![[ ]](/icons/layout.gif) | 3.04.0272-N-RA-PLUG-FOR-RG58-RG223-RG142-RG400-CABLE.pdf | 2025-07-19 00:13 | 209K | |
![[ ]](/icons/layout.gif) | 3.04.0273-N-JACK-FOR-RG8-CABLE.pdf | 2025-02-27 23:36 | 268K | |
![[ ]](/icons/layout.gif) | 3.04.0274-N-PLUG-FOR-250-CABLE.pdf | 2025-02-03 00:08 | 208K | |
![[ ]](/icons/layout.gif) | 3.04.0277-N-PLUG-FOR-RG316-CABLE.pdf | 2025-08-25 23:46 | 269K | |
![[ ]](/icons/layout.gif) | 3.04.0281-N-PLUG-FOR -LMR400-CABLE.pdf | 2025-05-07 21:08 | 205K | |
![[ ]](/icons/layout.gif) | 3.04.0287#N-PLUG-FOR-LMR400-CABLE.pdf | 2025-08-06 19:34 | 264K | |
![[ ]](/icons/layout.gif) | 3.04.0287-N-PLUG-FOR-LMR400-CABLE-V2.pdf | 2025-08-21 14:13 | 284K | |
![[ ]](/icons/layout.gif) | 3.04.0290-N-JACK-FLANGE-MOUNTED-CONNECTOR.pdf | 2025-07-15 10:49 | 204K | |
![[ ]](/icons/layout.gif) | 3.04.0291-N-JACK-FLANGE-MOUNTING-FOR-RG141-CABLE.pdf | 2025-07-09 00:29 | 211K | |
![[ ]](/icons/layout.gif) | 3.04.0292-N-JACK-FLANGE-MOUNTING-FOR-RG58-CABLE.pdf | 2025-07-21 11:39 | 213K | |
![[ ]](/icons/layout.gif) | 3.04.0296-N-JACK-FOR-086CABLE.pdf | 2025-07-18 00:30 | 179K | |
![[ ]](/icons/layout.gif) | 3.04.0310-N-PLUG-CLAMPING-FOR-LMR500-CABLE.pdf | 2025-11-25 11:50 | 352K | |
![[ ]](/icons/layout.gif) | 3.04.0311-N-JACK-FOR-141-CABLE.pdf | 2025-11-14 02:48 | 297K | |
![[ ]](/icons/layout.gif) | 3.04.0312-N-RA-PLUG-FOR-250-CABLE.pdf | 2025-11-07 22:29 | 299K | |
![[ ]](/icons/layout.gif) | 3.04.074-N-PLUG-FOR-RG58-RG223-CABLE.pdf | 2025-08-20 00:23 | 2.5M | |
![[ ]](/icons/layout.gif) | 3.05.093-BNC-PLUG-FOR-RG58-RG223-CABLE.pdf | 2025-08-23 23:30 | 211K | |
![[ ]](/icons/layout.gif) | 3.05.094-BNC-PLUG-FOR-LMR400-CABLE.pdf | 2025-08-23 23:46 | 212K | |
![[ ]](/icons/layout.gif) | 3.08.025-UHF-Plug-Clamp-Straight-for-RG213-Cable.pdf | 2025-08-12 22:43 | 181K | |
![[ ]](/icons/layout.gif) | 3.08.025-UHF-Plug-Clamp-Straight-for-RG213Cable.pdf | 2025-08-12 22:57 | 2.4M | |
![[ ]](/icons/layout.gif) | 3.08.026-UHF-Male-Crimp-Straight-for-RG58-Cable.pdf | 2025-08-23 20:51 | 176K | |
![[ ]](/icons/layout.gif) | 3.13.063-MCX-PLUG-FOR-RG58-CABLE.pdf | 2025-11-08 22:26 | 294K | |
![[ ]](/icons/layout.gif) | 3.13.064-MCX-PLUG-FOR-RG316-CABLE.pdf | 2025-11-08 21:29 | 294K | |
![[ ]](/icons/layout.gif) | 3.14.010#MMCX-PLUG-FOR-RG316-CABLE.pdf | 2025-09-13 17:24 | 205K | |
![[ ]](/icons/layout.gif) | 3.14.010-MMCX-PLUG-FOR-RG316-CABLE.pdf | 2025-09-13 17:25 | 205K | |
![[ ]](/icons/layout.gif) | 3.14.022-MMCX-R-A-PLUG-SOLDER-FOR-RG405-CABLE.pdf | 2025-08-23 01:11 | 203K | |
![[ ]](/icons/layout.gif) | 3.14.039-MMCX-male-right-angle-crimp-for-RG316.pdf | 2025-08-27 00:15 | 253K | |
![[ ]](/icons/layout.gif) | 3.17.011-N-RIGNT-ANGLE-PLUG-TO-JACK-RF-ADAPTER.pdf | 2025-06-07 19:03 | 204K | |
![[ ]](/icons/layout.gif) | 3.17.098-N-JACK-TO-N-JACK-RF-ADAPTOR.pdf | 2025-08-12 23:24 | 206K | |
![[ ]](/icons/layout.gif) | 3.17.106-BNC-PLUG-TO-UHF-JACK-RF-ADAPTER.pdf | 2025-11-08 20:14 | 247K | |
![[ ]](/icons/layout.gif) | 3.17.126-SMA-JACK-TO-MCX-PLUG0-ADAPTOR.pdf | 2025-06-24 19:40 | 255K | |
![[ ]](/icons/layout.gif) | 3.17.127-SMA-JACK-TO-N-JACK-WITH-4-HOLE-FLANGE-ADAPTOR.pdf | 2025-05-30 22:42 | 204K | |
![[ ]](/icons/layout.gif) | 3.17.128-SMA-JACK-TO-SMA-JACK-ADAPTOR.pdf | 2025-06-22 00:13 | 254K | |
![[ ]](/icons/layout.gif) | 3.17.129-SMA-PLUG-TO-SMA-PLUG-ADAPTOR.pdf | 2025-06-22 00:29 | 254K | |
![[ ]](/icons/layout.gif) | 3.17.130-RP-SMA-JACK-TO-SMA-JACK-ADAPTOR.pdf | 2025-06-21 23:45 | 254K | |
![[ ]](/icons/layout.gif) | 3.17.131-RP-SMA-PLUG-TO-SMA-PLUG-ADAPTOR.pdf | 2025-06-21 23:28 | 254K | |
![[ ]](/icons/layout.gif) | 3.17.132-N-PLUG-TO-SMA-JACK-ADAPTOR.pdf | 2025-06-25 23:40 | 202K | |
![[ ]](/icons/layout.gif) | 3.17.133-N-JACK-TO-SMA-JACK-ADAPTOR.pdf | 2025-06-26 00:18 | 254K | |
![[ ]](/icons/layout.gif) | 3.17.134-N-JACK-TO-SMA-PLUG-ADAPTOR.pdf | 2025-07-27 00:05 | 256K | |
![[ ]](/icons/layout.gif) | 3.17.137-N-Plug-To-N-Plug-Straight-Adapter.pdf | 2025-08-05 23:59 | 201K | |
![[ ]](/icons/layout.gif) | 3.17.141-RP-SMA-Jack-to-SMA-Plug-Straight-Adapter.pdf | 2025-08-12 23:51 | 203K | |
![[ ]](/icons/layout.gif) | 3.17.143-BNC-PLUG-TO-N-JACK-RF-ADAPTER.pdf | 2025-08-10 00:20 | 203K | |
![[ ]](/icons/layout.gif) | 3.17.154-RP-SMA-Plug-to-SMA-Jack-Straight-Adapter.pdf | 2025-08-12 23:41 | 202K | |
![[ ]](/icons/layout.gif) | 3.17.155-RP-SMA-Jack-to-N-Plug-Straight-Adapter.pdf | 2025-08-13 21:48 | 202K | |
![[ ]](/icons/layout.gif) | 3.17.156-BNC-PLUG-TO-SMA-JACK-ADAPTOR.pdf | 2025-08-13 21:22 | 203K | |
![[ ]](/icons/layout.gif) | 3.17.161-SMA-JACK-TO-SMA-JACK-FLANGED-MOUNTING-ADAPTOR.pdf | 2025-11-09 20:34 | 281K | |
![[ ]](/icons/layout.gif) | 3.17.162-N-JACK-TO-N-JACK-FLANGED-MOUNTING-ADAPTOR.pdf | 2025-11-08 19:38 | 279K | |
![[ ]](/icons/layout.gif) | 3.17.163-SMA-JACK-TO-MMCX-PLUG-FLANGED-MOUNTING-ADAPTOR.pdf | 2025-11-09 21:58 | 290K | |
![[ ]](/icons/layout.gif) | 3.17.164-BNC-JACK-TO-UHF-PLUG-RF-ADAPTER.pdf | 2025-11-17 00:49 | 247K | |
![[ ]](/icons/layout.gif) | 3.19.186-N-JACK-TO-IPEX-MHFI-FOR-RG178-CABLE.pdf | 2025-11-07 12:50 | 1.5M | |
![[ ]](/icons/layout.gif) | 3.19.189-N-JACK-TO-IPEX1-FOR-RG178-CABLE-15CM.pdf | 2025-11-07 12:47 | 249K | |
![[ ]](/icons/layout.gif) | 3BS27 PRO PicoCell техническое описание.pdf | 2019-03-21 13:02 | 3.4M | |
![[ ]](/icons/layout.gif) | 5BS27 PRO PicoCell техническое описание.pdf | 2019-03-21 13:00 | 3.7M | |
![[ ]](/icons/layout.gif) | 5SX17 PicoCell техническое описание.pdf | 2019-03-21 12:56 | 3.8M | |
![[ ]](/icons/layout.gif) | 7-8-D-PE-41010300014.pdf | 2025-02-11 00:45 | 212K | |
![[ ]](/icons/layout.gif) | 15m-HiBoost-200-Coax-Cable-1.pdf | 2023-02-17 14:39 | 513K | |
![[ ]](/icons/layout.gif) | 25-01-TGN.pdf | 2024-04-16 22:36 | 126K | |
![[ ]](/icons/layout.gif) | 25-02-1-TGN.pdf | 2024-04-16 22:36 | 114K | |
![[ ]](/icons/layout.gif) | 25-03-TGN.pdf | 2024-04-16 22:36 | 118K | |
![[ ]](/icons/layout.gif) | 25-04-TGN.pdf | 2024-04-16 22:36 | 114K | |
![[ ]](/icons/layout.gif) | 25-05-RP-TGN.pdf | 2024-04-16 22:36 | 130K | |
![[ ]](/icons/layout.gif) | 25-05-TGN.pdf | 2024-04-16 22:36 | 129K | |
![[ ]](/icons/layout.gif) | 25-06-RP-TGN.pdf | 2024-04-16 22:36 | 114K | |
![[ ]](/icons/layout.gif) | 25-06-TGN.pdf | 2024-04-16 22:36 | 113K | |
![[ ]](/icons/layout.gif) | 25-07-RP-TGN.pdf | 2024-04-16 22:36 | 131K | |
![[ ]](/icons/layout.gif) | 25-07-TGN.pdf | 2024-04-16 22:36 | 130K | |
![[ ]](/icons/layout.gif) | 25-08-RP-TGN.pdf | 2024-04-16 22:36 | 115K | |
![[ ]](/icons/layout.gif) | 25-08-TGN.pdf | 2024-04-16 22:36 | 114K | |
![[ ]](/icons/layout.gif) | 25-09-TGN.pdf | 2024-04-16 22:36 | 119K | |
![[ ]](/icons/layout.gif) | 25-10-TGN.pdf | 2024-04-16 22:36 | 109K | |
![[ ]](/icons/layout.gif) | 25-11-S1-RP-TGN.pdf | 2024-04-16 22:36 | 129K | |
![[ ]](/icons/layout.gif) | 25-11-S1-TGN.pdf | 2024-04-16 22:36 | 126K | |
![[ ]](/icons/layout.gif) | 25-12-RP-TGN.pdf | 2024-04-16 22:36 | 116K | |
![[ ]](/icons/layout.gif) | 25-12-TGN.pdf | 2024-04-16 22:36 | 114K | |
![[ ]](/icons/layout.gif) | 25-13-TGN.pdf | 2024-04-16 22:36 | 98K | |
![[ ]](/icons/layout.gif) | 25-15-TGN.pdf | 2024-04-16 22:36 | 112K | |
![[ ]](/icons/layout.gif) | 25-16-TGN.pdf | 2024-04-16 22:36 | 122K | |
![[ ]](/icons/layout.gif) | 25-17-TGN.pdf | 2024-04-16 22:36 | 116K | |
![[ ]](/icons/layout.gif) | 25-18-TGN.pdf | 2024-04-16 22:36 | 112K | |
![[ ]](/icons/layout.gif) | 25-19-TGN.pdf | 2024-04-16 22:36 | 116K | |
![[ ]](/icons/layout.gif) | 25-20-TGN.pdf | 2024-04-16 22:36 | 121K | |
![[ ]](/icons/layout.gif) | 35ft-10.6mHiboost-300-Coax-Cable.pdf | 2023-05-02 16:40 | 275K | |
![[ ]](/icons/layout.gif) | 670-086-50-FEP-Base-Station-RF-Coaxial-Cable-V1.0 41010100013-75-80-146-147 2022-07-21.pdf | 2025-08-09 00:51 | 376K | |
![[ ]](/icons/layout.gif) | 670-086-50 FEP Base Station RF Coaxial Cable V1.0 41010100023-24-26-43-84(0-6G)2022-9-13.pdf | 2023-12-07 10:45 | 1.0M | |
![[ ]](/icons/layout.gif) | 670-141 FEP Base Station RF Coaxial Cable V1.0 41010100292-310-317-318-341-342 2023-2-22.pdf | 2023-12-06 19:08 | 1.0M | |
![[ ]](/icons/layout.gif) | 670-250-50-FEP-Specification-V1.1-41010100010-54-62.pdf | 2025-08-28 23:34 | 969K | |
![[ ]](/icons/layout.gif) | 900 BST PicoCell техническое описание.pdf | 2019-03-21 13:15 | 214K | |
![[ ]](/icons/layout.gif) | 900 SXA PicoCell техническое описание.pdf | 2019-03-21 12:47 | 724K | |
![[ ]](/icons/layout.gif) | 900 SXL PicoCell техническое описание.pdf | 2019-03-21 12:50 | 182K | |
![[ ]](/icons/layout.gif) | 900 SXM PicoCell техническое описание.pdf | 2019-03-21 12:44 | 337K | |
![[ ]](/icons/layout.gif) | 900 SXT PicoCell описание модема.pdf | 2019-03-21 12:22 | 287K | |
![[ ]](/icons/layout.gif) | 900 SXT PicoCell техническое описание.pdf | 2019-03-21 12:22 | 483K | |
![[ ]](/icons/layout.gif) | 900sx20 | 1800 SX20 PicoCell инструкция по эксплуатации.pdf | 2019-03-20 17:44 | 2.9M | |
![[ ]](/icons/layout.gif) | 900|1800 SXA PicoCell техническое описание.pdf | 2019-03-21 12:40 | 934K | |
![[ ]](/icons/layout.gif) | 1800 SXB PicoCell техническое описание.pdf | 2019-03-21 14:00 | 537K | |
![[ ]](/icons/layout.gif) | 1800_BST_PicoCell_техническое_описание.pdf | 2019-06-09 13:56 | 360K | |
![[ ]](/icons/layout.gif) | 1800_SXL_PicoCell_техническое_описание.pdf | 2019-06-09 13:41 | 314K | |
![[ ]](/icons/layout.gif) | 100024015-assembly-instruction.pdf | 2023-07-14 23:23 | 47K | |
![[ ]](/icons/layout.gif) | 41010300009-1-2-D-PE-4GHz.pdf | 2024-10-28 23:20 | 762K | |
![[ ]](/icons/layout.gif) | 41010400026-KSR400-PE-TCCAA.pdf | 2025-09-25 00:51 | 776K | |
![[ ]](/icons/layout.gif) | 41010600036-RG214-PVC.pdf | 2024-12-25 00:36 | 344K | |
![[ ]](/icons/layout.gif) | 41010700004---Maxflex086.pdf | 2025-09-12 15:10 | 111K | |
![[ ]](/icons/layout.gif) | 41050300021-RG174.pdf | 2025-09-24 00:01 | 1.3M | |
![[ ]](/icons/layout.gif) | 45010104235-RP-SMAM-KSR-195-Specification.pdf | 2025-07-19 20:37 | 159K | |
![[ ]](/icons/layout.gif) | 45010104235-RP-SMAM-KSR195-Specification.pdf | 2025-07-19 20:28 | 98K | |
![[ ]](/icons/layout.gif) | 45010104236-SMAM-KSR240-Specification.pdf | 2025-05-22 00:46 | 118K | |
![[ ]](/icons/layout.gif) | 45010104237-RP-SMAM-KSR240-Specification.pdf | 2025-05-21 00:41 | 106K | |
![[ ]](/icons/layout.gif) | 45010203796-NM-1-2L-Specification.pdf | 2025-02-20 23:37 | 329K | |
![[ ]](/icons/layout.gif) | 45010203886-NM-1-2S-Specification.pdf | 2025-05-20 23:54 | 106K | |
![[ ]](/icons/layout.gif) | 45010203960-NM-7-8L-Specification.pdf | 2025-05-21 00:12 | 100K | |
![[ ]](/icons/layout.gif) | 45010203961-NF-KSR195-Crimp-Specification-Rev.pdf | 2025-05-21 00:31 | 122K | |
![[ ]](/icons/layout.gif) | 45010203961-NF-KSR195-Crimp-Specification.pdf | 2025-05-21 00:29 | 122K | |
![[ ]](/icons/layout.gif) | 45010203962-NM-KSR195-Crimp-Specification.pdf | 2025-07-04 22:23 | 115K | |
![[ ]](/icons/layout.gif) | 45010203963-NM-KSR240-Crimp-Specification.pdf | 2025-05-27 21:46 | 105K | |
![[ ]](/icons/layout.gif) | 45010203964-NF-KSR400-Crimp-Specification-rev.2.pdf | 2025-05-22 01:14 | 130K | |
![[ ]](/icons/layout.gif) | 45010203964-NF-KSR400-Crimp-Specification-rev.pdf | 2025-05-22 01:12 | 129K | |
![[ ]](/icons/layout.gif) | 45010203964-NF-KSR400-Crimp-Specification.pdf | 2025-05-22 01:07 | 110K | |
![[ ]](/icons/layout.gif) | 45010203979-NM-KSR600-clamp-Specification.pdf | 2025-06-13 00:11 | 176K | |
![[ ]](/icons/layout.gif) | AC-Lite UniFi быстрый старт.pdf | 2019-04-20 15:43 | 4.6M | |
![[ ]](/icons/layout.gif) | ADAPTOR-4-KITs-PERFORMANCE.pdf | 2024-11-08 23:21 | 85K | |
![[ ]](/icons/layout.gif) | ADAPTOR 4 KITs PERFORMANCE.pdf | 2024-11-08 23:21 | 85K | |
![[ ]](/icons/layout.gif) | AL-600-PowerEdge-інструкція.pdf | 2023-02-01 20:51 | 2.2M | |
![[ ]](/icons/layout.gif) | AL-600-flyer.pdf | 2023-02-01 21:35 | 229K | |
![[ ]](/icons/layout.gif) | AO-700-2700-4 антенна техническое описание.pdf | 2019-03-21 13:23 | 1.0M | |
![[ ]](/icons/layout.gif) | AP-450-6-ID антенна техническое описание.pdf | 2019-03-21 13:26 | 719K | |
![[ ]](/icons/layout.gif) | AP-450-6-OD антенна техническое описание.pdf | 2019-03-21 13:26 | 874K | |
![[ ]](/icons/layout.gif) | AP-800-2500-7-9-ID антенна техническое описание.pdf | 2019-03-21 13:27 | 917K | |
![[ ]](/icons/layout.gif) | AP-800-2700-7-9-OD антенна техническое описание.pdf | 2019-03-21 13:27 | 1.3M | |
![[ ]](/icons/layout.gif) | AP-800-2700-10-15_OD_PicoCell_Техническое_описание.pdf | 2020-12-03 12:01 | 257K | |
![[ ]](/icons/layout.gif) | AP-1700-2700-12-15 OD MIMO Техническое описание.pdf | 2021-02-15 10:55 | 156K | |
![[ ]](/icons/layout.gif) | AP-GS1002 техническое описание.pdf | 2019-04-11 14:16 | 215K | |
![[ ]](/icons/layout.gif) | AP Pro быстрый старт.pdf | 2019-04-20 16:35 | 3.0M | |
![[ ]](/icons/layout.gif) | ARK-1124C-A3_datasheet.pdf | 2022-10-07 17:03 | 1.3M | |
![[ ]](/icons/layout.gif) | ARK-1124U-A3_datasheet.pdf | 2022-10-07 17:30 | 1.3M | |
![[ ]](/icons/layout.gif) | ART-800 техническое описание.pdf | 2019-04-18 00:04 | 352K | |
![[ ]](/icons/layout.gif) | ART900 техническое описание.pdf | 2019-04-17 23:47 | 344K | |
![[ ]](/icons/compressed.gif) | ATM21 iRZ драйвер USB для настройки модема.zip | 2019-03-21 17:53 | 7.3K | |
![[ ]](/icons/layout.gif) | ATM21 iRZ руководство пользователя краткое.pdf | 2019-03-21 17:48 | 7.3M | |
![[ ]](/icons/layout.gif) | ATM21 iRZ руководство пользователя.pdf | 2019-03-21 17:48 | 1.2M | |
![[ ]](/icons/layout.gif) | ATM21 iRZ техническое описание.pdf | 2019-03-21 17:48 | 6.8M | |
![[ ]](/icons/unknown.gif) | ATM Control SE программа настройки модема.rar | 2019-03-21 17:53 | 13M | |
![[ ]](/icons/layout.gif) | ATM Control SE руководство по работе с программой настройки модемов.pdf | 2019-03-21 17:48 | 1.9M | |
![[ ]](/icons/layout.gif) | ATP2410 CarpeStar техническое описание.pdf | 2019-03-27 13:10 | 412K | |
![[ ]](/icons/layout.gif) | Advantech_ICR1601_DataSheet.pdf | 2022-10-04 13:33 | 326K | |
![[ ]](/icons/layout.gif) | Advantech_SmartFlex_SR303_DataSheet.pdf | 2022-10-04 14:06 | 603K | |
![[ ]](/icons/layout.gif) | Advantech_UR5iv2_Libratum_Metal_DataSheet.pdf | 2022-10-04 14:08 | 291K | |
![[ ]](/icons/layout.gif) | Advantech_icr-3200-configuration-manual-20190702.pdf | 2022-10-04 14:21 | 5.1M | |
![[ ]](/icons/layout.gif) | Advantech_lr-77-v2l-user-s-manual-20190404.pdf | 2022-10-04 14:46 | 2.8M | |
![[ ]](/icons/layout.gif) | Airborne 5 - Full Datasheet ENG.pdf | 2023-06-13 21:18 | 613K | |
![[ ]](/icons/layout.gif) | Automotive-Power-Supply-058R-00249-v1.2_техническое_описание.pdf | 2020-05-20 23:17 | 157K | |
![[ ]](/icons/layout.gif) | B315s-22 Краткое руководство пользователя.pdf | 2019-05-31 12:38 | 1.3M | |
![[ ]](/icons/layout.gif) | BAT120_Flyer.pdf | 2022-11-23 22:36 | 1.1M | |
![[ ]](/icons/layout.gif) | BAT120_QSG.pdf | 2022-11-23 22:36 | 181K | |
![[ ]](/icons/layout.gif) | BAT120_Use_Case.pdf | 2022-11-23 22:36 | 1.5M | |
![[ ]](/icons/layout.gif) | BGS2T Cinterion техническая документация.pdf | 2019-03-20 16:43 | 3.4M | |
![[ ]](/icons/layout.gif) | BNC-04F-TGN.pdf | 2024-11-10 23:19 | 169K | |
![[ ]](/icons/layout.gif) | BNC-04T-1-TGN.pdf | 2024-11-11 00:39 | 170K | |
![[ ]](/icons/layout.gif) | BladeRF 2.0 micro xA4 SDR datasheet.pdf | 2023-12-13 23:15 | 366K | |
![[ ]](/icons/layout.gif) | Brochure-for-AK-40-WIFI-TGN.pdf | 2024-04-16 22:28 | 1.0M | |
![[ ]](/icons/layout.gif) | C13L Series Single Band Repeater Amplitec.pdf | 2022-11-26 17:45 | 280K | |
![[ ]](/icons/layout.gif) | C17L Dual Band Series User Manual.pdf | 2022-11-26 18:06 | 1.9M | |
![[ ]](/icons/layout.gif) | C20L triple band series.pdf | 2022-12-05 23:58 | 1.1M | |
![[ ]](/icons/layout.gif) | C20W Series Triple Band Repeater.pdf | 2023-03-02 19:57 | 237K | |
![[ ]](/icons/layout.gif) | C20W series user manual .pdf | 2023-03-02 19:57 | 953K | |
![[ ]](/icons/layout.gif) | C20W series user manual_V2.pdf | 2023-04-25 17:25 | 1.0M | |
![[ ]](/icons/layout.gif) | C23S Dual Band User Manual.pdf | 2023-02-10 12:38 | 2.3M | |
![[ ]](/icons/layout.gif) | C23S Series Dual band signal repeater.pdf | 2022-12-05 23:57 | 939K | |
![[ ]](/icons/layout.gif) | CB-316U-045-020.pdf | 2024-07-12 16:07 | 154K | |
![[ ]](/icons/layout.gif) | CB-U.FL-022-015-V2.pdf | 2024-07-12 15:57 | 153K | |
![[ ]](/icons/layout.gif) | CB-U.FL-022-015.pdf | 2024-07-05 22:52 | 151K | |
![[ ]](/icons/layout.gif) | CB-U.FL-043-015.pdf | 2024-07-14 12:29 | 158K | |
![[ ]](/icons/layout.gif) | CCR2004-1G-12S2XS_230155.pdf | 2023-03-18 22:38 | 1.0M | |
![[ ]](/icons/layout.gif) | CCR2216-1G-12XS-2XQ_220226.pdf | 2023-03-18 21:49 | 1.9M | |
![[ ]](/icons/layout.gif) | CE Certification GTS201712000042E01 EN 301489&EN55032 .pdf | 2022-11-20 11:27 | 2.8M | |
![[ ]](/icons/layout.gif) | CE Certification GTS201712000042E02 EN301511&EN301908.pdf | 2022-11-20 11:27 | 659K | |
![[ ]](/icons/layout.gif) | CE Certification GTS201712000042E03 EN 62311.pdf | 2022-11-20 11:27 | 457K | |
![[ ]](/icons/layout.gif) | CE Certification GTS201712000042EV1 RED.pdf | 2022-11-20 11:27 | 220K | |
![[ ]](/icons/layout.gif) | CEL-FI GO X техническое описание.pdf | 2019-03-21 14:05 | 438K | |
![[ ]](/icons/layout.gif) | CELFI-ROAM-R41-Datasheet.pdf | 2023-08-22 21:29 | 864K | |
![[ ]](/icons/layout.gif) | CMG CarpeStar инструкция пользователя.pdf | 2019-03-27 11:27 | 5.5M | |
![[ ]](/icons/layout.gif) | CP860 инструкция пользователя.pdf | 2019-04-12 19:06 | 3.7M | |
![[ ]](/icons/layout.gif) | CP860 техническое описание.pdf | 2019-04-12 19:06 | 706K | |
![[ ]](/icons/layout.gif) | CP920 быстрый старт.pdf | 2019-04-17 14:45 | 593K | |
![[ ]](/icons/layout.gif) | CP920 техническое описание.pdf | 2019-04-17 14:45 | 594K | |
![[ ]](/icons/layout.gif) | CRS310-1G-5S-4SIN_220314.pdf | 2023-03-18 21:31 | 1.3M | |
![[ ]](/icons/layout.gif) | CST-400-datasheet.pdf | 2024-01-12 22:02 | 131K | |
![[ ]](/icons/layout.gif) | Cel-Fi DUO краткое описание.pdf | 2019-04-11 13:42 | 344K | |
![[ ]](/icons/layout.gif) | Cel-Fi DUO руководство по быстрой установке.pdf | 2019-04-11 13:42 | 1.2M | |
![[ ]](/icons/layout.gif) | Cel-Fi PRIME краткое описание.pdf | 2019-04-11 13:46 | 1.0M | |
![[ ]](/icons/layout.gif) | Cel-Fi PRIME руководство по быстрой установке.pdf | 2019-04-11 13:46 | 1.5M | |
![[ ]](/icons/layout.gif) | Cel-Fi SOLO Инструкция пользователя.pdf | 2021-02-11 12:19 | 5.0M | |
![[ ]](/icons/layout.gif) | Cel-Fi SOLO Техническое описание.pdf | 2021-02-11 12:19 | 314K | |
![[ ]](/icons/layout.gif) | CelFi_Mobile_Donor_Antennas_datasheet.pdf | 2022-10-12 15:50 | 342K | |
![[ ]](/icons/layout.gif) | CellMeter_X3LTE_техническое_описание.pdf | 2019-08-28 13:52 | 348K | |
![[ ]](/icons/layout.gif) | Cellular_Meter_2G:3G_техническое_описание.pdf | 2019-06-06 17:41 | 584K | |
![[ ]](/icons/layout.gif) | Cloud Key быстрый старт.pdf | 2019-04-20 15:28 | 3.9M | |
![[ ]](/icons/layout.gif) | Cloud Key техническое описание.pdf | 2019-04-20 15:28 | 3.2M | |
![[ ]](/icons/layout.gif) | Cloud Key G2 техническое описание.pdf | 2019-04-21 01:00 | 4.0M | |
![[ ]](/icons/layout.gif) | Cloud Key G2 Plus техническое описание.pdf | 2019-04-21 00:39 | 6.6M | |
![[ ]](/icons/layout.gif) | Coaxial_Cables_T00013A0203.pdf | 2023-11-07 20:42 | 925K | |
![[ ]](/icons/layout.gif) | Combo-Mimo-Mobile-GNSS-WIFI-Roof-SMA-Antenna-003R-00253-v1.2_техническое_описание.pdf | 2020-05-20 22:43 | 152K | |
![[ ]](/icons/layout.gif) | Combo-Siso-Mobile-GNSS-WiFi-Roof-SMA-Antenna-003R-00254-v1.3_техническое_описание.pdf | 2020-05-20 22:38 | 147K | |
![[ ]](/icons/layout.gif) | Compact-Din-Rail-Kit-088-00270-v1.4_техническое_описание.pdf | 2020-05-20 22:52 | 379K | |
![[ ]](/icons/layout.gif) | Connector-Instalation-Instruction.pdf | 2025-02-17 18:47 | 351K | |
![[ ]](/icons/layout.gif) | Connector-Installation-Instruction-N-male-1:2.pdf | 2023-06-25 15:46 | 516K | |
![[ ]](/icons/layout.gif) | Connectors_for_Low_Loss_Cables_T00013A0319.pdf | 2023-07-14 23:23 | 7.6M | |
![[ ]](/icons/layout.gif) | Crimping Tool datasheet.pdf | 2024-07-12 22:25 | 2.2M | |
![[ ]](/icons/compressed.gif) | D80 Conf tool v1.0.10.zip | 2022-11-26 00:15 | 356K | |
![[ ]](/icons/layout.gif) | D80 Serial to IP 4G Modem-Datasheet.pdf | 2022-11-19 22:39 | 2.1M | |
![[ ]](/icons/layout.gif) | D80 Serial to IP 4G Modem-User-manual.pdf | 2022-11-19 22:40 | 1.0M | |
![[ ]](/icons/layout.gif) | DAG1000-4FXS_техническое_описание.pdf | 2019-06-20 14:41 | 569K | |
![[ ]](/icons/layout.gif) | DAG1000-8FXS_инструкция_пользователя.pdf | 2019-06-20 14:28 | 144K | |
![[ ]](/icons/layout.gif) | DAG1000-8FXS_техническое _описание.pdf | 2019-06-20 14:28 | 653K | |
![[ ]](/icons/layout.gif) | DL-330K-RF-Tool-Box-Set-datasheet.pdf | 2024-07-12 17:13 | 1.1M | |
![[ ]](/icons/layout.gif) | DP720 быстрый старт.pdf | 2019-04-12 17:29 | 3.3M | |
![[ ]](/icons/layout.gif) | DP720 техническое описание.pdf | 2019-04-12 17:30 | 534K | |
![[ ]](/icons/layout.gif) | DP722 быстрый старт.pdf | 2019-04-12 17:41 | 6.6M | |
![[ ]](/icons/layout.gif) | DP722 техническое описание.pdf | 2019-04-12 17:41 | 7.3M | |
![[ ]](/icons/layout.gif) | DP730 быстрый старт.pdf | 2019-04-12 17:46 | 5.1M | |
![[ ]](/icons/layout.gif) | DP730 техническое описание.pdf | 2019-04-12 17:46 | 557K | |
![[ ]](/icons/layout.gif) | DP750 быстрый старт.pdf | 2019-04-12 17:36 | 1.6M | |
![[ ]](/icons/layout.gif) | DP750 техническое описание.pdf | 2019-04-12 17:36 | 564K | |
![[ ]](/icons/layout.gif) | DP750, DP720 инструкция пользователя.pdf | 2019-04-12 17:29 | 2.4M | |
![[ ]](/icons/layout.gif) | DP752 быстрый старт.pdf | 2019-04-12 17:44 | 12M | |
![[ ]](/icons/layout.gif) | DP752 техническое описание.pdf | 2019-04-12 17:44 | 733K | |
![[ ]](/icons/layout.gif) | DP752, DP730, DP722 инструкция пользователя.pdf | 2019-04-12 17:41 | 2.3M | |
![[ ]](/icons/layout.gif) | DP760 быстрый старт.pdf | 2019-04-12 16:45 | 1.7M | |
![[ ]](/icons/layout.gif) | DP760 инструкция пользователя.pdf | 2019-04-12 16:45 | 1.2M | |
![[ ]](/icons/layout.gif) | DP760 техническое описание.pdf | 2019-04-12 16:45 | 668K | |
![[ ]](/icons/layout.gif) | DQ0727-22N.pdf | 2024-09-06 09:36 | 165K | |
![[ ]](/icons/layout.gif) | DTP800 техническое описание.pdf | 2019-03-27 15:05 | 399K | |
![[ ]](/icons/layout.gif) | Data Sheet Low Loss 195 Coax-Cable, 100±1m RingL01020C0023KP.pdf | 2023-09-29 23:22 | 62K | |
![[ ]](/icons/layout.gif) | Data sheet RigExpert© AA-35 ZOOM.pdf | 2023-04-14 14:59 | 225K | |
![[ ]](/icons/layout.gif) | Data sheet RigExpert© AA-55 ZOOM.pdf | 2023-04-14 14:59 | 212K | |
![[ ]](/icons/layout.gif) | Data sheet RigExpert© AA-230 ZOOM.pdf | 2023-04-14 14:59 | 208K | |
![[ ]](/icons/layout.gif) | Data sheet RigExpert© AA-650 ZOOM.pdf | 2023-04-13 10:47 | 244K | |
![[ ]](/icons/layout.gif) | Data sheet RigExpert© AA-1500 ZOOM.pdf | 2023-04-13 10:45 | 242K | |
![[ ]](/icons/layout.gif) | Data sheet RigExpert© AA-2000 ZOOM.pdf | 2023-04-13 10:46 | 240K | |
![[ ]](/icons/layout.gif) | Data sheet RigExpert© Stick Pro.pdf | 2023-04-13 10:50 | 234K | |
![[ ]](/icons/layout.gif) | Data sheet RigExpert© Stick XPro.pdf | 2023-04-13 10:48 | 191K | |
![[ ]](/icons/layout.gif) | Data sheet RigExpert® Stick 230.pdf | 2023-04-13 11:53 | 213K | |
![[ ]](/icons/layout.gif) | Data sheet RigExpert® Stick 500.pdf | 2023-04-13 11:42 | 226K | |
![[ ]](/icons/layout.gif) | Din-Rail-Kit-088-00267_Техническое описание.pdf | 2020-12-25 16:03 | 530K | |
![[ ]](/icons/layout.gif) | Dinstar UC2000 VE техническое описание.pdf | 2019-04-11 12:10 | 374K | |
![[ ]](/icons/layout.gif) | Dinstar_SIMCloud&SIMbank_Datasheet.pdf | 2023-07-05 23:44 | 1.5M | |
![[ ]](/icons/layout.gif) | E.0019-2022_NM-12-YH22.pdf | 2024-02-10 16:04 | 152K | |
![[ ]](/icons/layout.gif) | E.0046-NM-NM-YC20.pdf | 2025-07-04 16:39 | 386K | |
![[ ]](/icons/layout.gif) | EHS6T техническое описание.pdf | 2019-03-27 22:54 | 729K | |
![[ ]](/icons/layout.gif) | EM-TC006-RG174-NGT.pdf | 2024-03-12 22:37 | 480K | |
![[ ]](/icons/layout.gif) | EM-TC006A-RG174-NGT-2-datasheet-installation.pdf | 2023-06-08 14:28 | 131K | |
![[ ]](/icons/binary.gif) | EM300-SLD v2 Firmware v1.22.0000.0210.0122.bin | 2023-01-28 00:58 | 148K | |
![[ ]](/icons/layout.gif) | ET_200X_инструкция_пользователя.pdf | 2019-06-07 15:01 | 4.1M | |
![[ ]](/icons/layout.gif) | ET_200X_техническое_описание.pdf | 2019-06-07 15:01 | 911K | |
![[ ]](/icons/layout.gif) | EWM-C118HD_datasheet.pdf | 2022-10-07 01:37 | 217K | |
![[ ]](/icons/layout.gif) | EXP20 техническое описание.pdf | 2019-04-17 17:37 | 607K | |
![[ ]](/icons/layout.gif) | EXP39 инструкция пользователя.pdf | 2019-04-12 18:03 | 1.6M | |
![[ ]](/icons/layout.gif) | EXP40 инструкция пользователя.pdf | 2019-04-12 18:08 | 2.1M | |
![[ ]](/icons/layout.gif) | F8L10GW LoRaWAN-шлюз_техническое_описание.pdf | 2019-06-13 00:24 | 966K | |
![[ ]](/icons/layout.gif) | FAT2710_техническое_описание.pdf | 2019-06-06 17:42 | 376K | |
![[ ]](/icons/layout.gif) | FIBARO вставное реле Relay Switch 2,5 kW — FIBEFGS-212 Инструкция по эксплуатации и технические характеристики.pdf | 2020-12-09 14:25 | 1.4M | |
![[ ]](/icons/layout.gif) | FIBARO DOOR:WINDOW SENSOR 2 FGDW-002 Техническое описание.pdf | 2020-12-12 16:35 | 1.0M | |
![[ ]](/icons/layout.gif) | FIBARO DOUBLE RELAY SWITCH FGS-221-RU-A-v1.02 РУКОВОДСТВО ПО ЭКСПЛУАТАЦИИ .pdf | 2020-12-09 11:57 | 1.3M | |
![[ ]](/icons/layout.gif) | FIBARO FGBHS-213 Инструкция пользователя.pdf | 2020-12-09 19:53 | 6.5M | |
![[ ]](/icons/layout.gif) | FIBARO FGBHS-213 Техническое описание.pdf | 2020-12-09 19:53 | 564K | |
![[ ]](/icons/layout.gif) | FIBARO HOME CENTER 2 - FIB_HOMEC2_Инструкция_пользователя.pdf | 2020-12-07 17:36 | 1.6M | |
![[ ]](/icons/layout.gif) | FIBARO HOME CENTER LITE - FIB_FGHCL_Инструкция_пользователя.pdf | 2020-12-07 17:39 | 3.9M | |
![[ ]](/icons/layout.gif) | FIBARO SINGLE:DOUBLE SWITCH 2, Z-WAVE PLUS Инструкция пользователя.pdf | 2020-12-09 20:59 | 878K | |
![[ ]](/icons/layout.gif) | FIBARO SMART MODULE FGS-214 DOUBLE SMART MODULE FGS-224 Инструкция пользователя и техническое описание.pdf | 2020-12-09 11:25 | 2.0M | |
![[ ]](/icons/layout.gif) | FIBARO Smoke Sensor — FIBEFGSD-002 Техническое описание.pdf | 2020-12-10 20:05 | 3.3M | |
![[ ]](/icons/layout.gif) | FIBARO_HOME_CENTER_3_FGHC3-S_Инструкция_пользователя.pdf | 2020-12-07 17:29 | 8.0M | |
![[ ]](/icons/layout.gif) | FMB001_руководство_пользователя.pdf | 2019-08-05 12:26 | 1.8M | |
![[ ]](/icons/layout.gif) | FMB001_техническое_описание.pdf | 2019-08-05 12:26 | 1.0M | |
![[ ]](/icons/layout.gif) | FSH6.pdf | 2025-03-26 00:27 | 9.3M | |
![[ ]](/icons/layout.gif) | Fobos SDR Quick Start Guide.pdf | 2024-04-17 21:50 | 5.9M | |
![[ ]](/icons/layout.gif) | G510 Series Router Datasheet.pdf | 2022-11-17 17:34 | 2.3M | |
![[ ]](/icons/layout.gif) | GAC500_инструкция_пользователя.pdf | 2019-06-25 19:14 | 5.0M | |
![[ ]](/icons/layout.gif) | GAC2500_техническое_описание.pdf | 2019-06-25 19:14 | 736K | |
![[ ]](/icons/layout.gif) | GBX20_datasheet.pdf | 2022-10-06 15:58 | 536K | |
![[ ]](/icons/layout.gif) | GDS3705 быстрый старт.pdf | 2019-04-17 12:06 | 11M | |
![[ ]](/icons/layout.gif) | GDS3705 техническое описание.pdf | 2019-04-17 12:06 | 1.3M | |
![[ ]](/icons/layout.gif) | GDS3710 быстрый старт.pdf | 2019-04-17 13:13 | 13M | |
![[ ]](/icons/layout.gif) | GDS3710 техническое описание.pdf | 2019-04-17 13:13 | 1.3M | |
![[ ]](/icons/layout.gif) | GKS-SP-15 KSR400 Data Sheet.pdf | 2023-12-24 20:43 | 820K | |
![[ ]](/icons/layout.gif) | GKS-SP-18 KSR300 Data Sheet.pdf | 2023-12-24 19:56 | 820K | |
![[ ]](/icons/layout.gif) | GKS-SP-20-KSR600-PE-41010400045.pdf | 2025-02-17 23:47 | 814K | |
![[ ]](/icons/layout.gif) | GKS-SP-69-RG213-PVC-41010600035.pdf | 2024-07-27 01:05 | 823K | |
![[ ]](/icons/layout.gif) | GKS-SP-180 KSR400 PVC.pdf | 2023-12-24 14:12 | 764K | |
![[ ]](/icons/layout.gif) | GKS-SP-186-KSR400UF-41010400001-V1.1.pdf | 2024-07-25 00:42 | 725K | |
![[ ]](/icons/layout.gif) | GKS-SP-330-KSR500-PVC-6GHz.pdf | 2024-10-25 22:50 | 246K | |
![[ ]](/icons/layout.gif) | GKS-SP-337-41010400348-KSR500-TC-PVC.pdf | 2024-10-28 10:05 | 350K | |
![[ ]](/icons/layout.gif) | GKS-SP-350-KSR300-PVC-V1.0.pdf | 2024-12-31 15:27 | 239K | |
![[ ]](/icons/layout.gif) | GKS-SP-382 -KSR600-PVC-41010400355.pdf | 2025-08-18 23:38 | 190K | |
![[ ]](/icons/layout.gif) | GOG41_datasheet - Ukrainian.pdf | 2023-04-20 12:31 | 527K | |
![[ ]](/icons/layout.gif) | GO M техническая спецификация.pdf | 2019-04-11 13:24 | 412K | |
![[ ]](/icons/layout.gif) | GRP2615_Datasheet_.pdf | 2022-10-06 16:13 | 609K | |
![[ ]](/icons/layout.gif) | GSC35XX_инструкция_пользователя.pdf | 2019-09-20 13:45 | 3.5M | |
![[ ]](/icons/layout.gif) | GSC3505_техническое_описание.pdf | 2019-09-20 13:59 | 844K | |
![[ ]](/icons/layout.gif) | GSC3510_техническое_описание.pdf | 2019-09-20 13:41 | 735K | |
![[ ]](/icons/layout.gif) | GVC320xx_инструкция_пользователя.pdf | 2019-08-30 16:16 | 8.3M | |
![[ ]](/icons/layout.gif) | GVC3200_инструкция_по_установке.pdf | 2019-08-30 16:19 | 27M | |
![[ ]](/icons/layout.gif) | GVC3200_техническое_описание.pdf | 2019-08-30 16:17 | 707K | |
![[ ]](/icons/layout.gif) | GWN7000 быстрый старт.pdf | 2019-04-17 14:25 | 4.3M | |
![[ ]](/icons/layout.gif) | GWN7000 техническое описание.pdf | 2019-04-17 14:25 | 1.1M | |
![[ ]](/icons/layout.gif) | GWN7600 быстрый старт.pdf | 2019-04-17 11:32 | 16M | |
![[ ]](/icons/layout.gif) | GWN7600 техническое описание.pdf | 2019-04-17 11:32 | 650K | |
![[ ]](/icons/layout.gif) | GWN7600LR быстрый старт.pdf | 2019-04-17 15:44 | 10M | |
![[ ]](/icons/layout.gif) | GWN7600_LR техническое описание.pdf | 2019-04-17 15:44 | 358K | |
![[ ]](/icons/layout.gif) | GWN7610 быстрый старт.pdf | 2019-04-16 18:37 | 16M | |
![[ ]](/icons/layout.gif) | GWN7610 техническое описание.pdf | 2019-04-16 18:37 | 627K | |
![[ ]](/icons/layout.gif) | GXP16XX быстрый старт.pdf | 2019-04-12 17:06 | 352K | |
![[ ]](/icons/layout.gif) | GXP16XX инструкция пользователя.pdf | 2019-04-12 17:06 | 1.2M | |
![[ ]](/icons/layout.gif) | GXP17XX быстрый старт.pdf | 2019-04-16 11:26 | 677K | |
![[ ]](/icons/layout.gif) | GXP1610, GXP1615 техническое описание.pdf | 2019-04-12 17:06 | 779K | |
![[ ]](/icons/layout.gif) | GXP1620, GXP1625 техническое описание.pdf | 2019-04-12 17:10 | 819K | |
![[ ]](/icons/layout.gif) | GXP1628 техническое описание.pdf | 2019-04-12 17:47 | 787K | |
![[ ]](/icons/layout.gif) | GXP1630 техническое описание.pdf | 2019-04-12 17:49 | 752K | |
![[ ]](/icons/layout.gif) | GXP1760 техническое описание.pdf | 2019-04-16 11:26 | 493K | |
![[ ]](/icons/layout.gif) | GXP1780, GXP1782 техническое описание.pdf | 2019-04-16 11:59 | 509K | |
![[ ]](/icons/layout.gif) | GXP2130 техническое описание.pdf | 2019-04-12 18:22 | 2.1M | |
![[ ]](/icons/layout.gif) | GXP2130, GXP2140, GXP2160, GXP2135, GXP2170 быстрый старт.pdf | 2019-04-12 18:29 | 351K | |
![[ ]](/icons/layout.gif) | GXP2135 техническое описание.pdf | 2019-04-12 18:31 | 1.8M | |
![[ ]](/icons/layout.gif) | GXP2140 техническое описание.pdf | 2019-04-12 18:38 | 877K | |
![[ ]](/icons/layout.gif) | GXP2160 техническое описание.pdf | 2019-04-12 18:20 | 929K | |
![[ ]](/icons/layout.gif) | GXP2170 быстрый старт.pdf | 2019-04-15 15:41 | 11M | |
![[ ]](/icons/layout.gif) | GXP2170 техническое описание.pdf | 2019-04-15 15:40 | 916K | |
![[ ]](/icons/layout.gif) | GXP2200EXT техническое описание.pdf | 2019-04-12 18:50 | 709K | |
![[ ]](/icons/layout.gif) | GXV3240 инструкция пользователя.pdf | 2019-04-12 18:55 | 479K | |
![[ ]](/icons/layout.gif) | GXV3240 техническое описание.pdf | 2019-04-12 18:55 | 825K | |
![[ ]](/icons/layout.gif) | GXV3275 инструкция пользователя.pdf | 2019-04-12 18:58 | 455K | |
![[ ]](/icons/layout.gif) | GXV3275 техническое описание.pdf | 2019-04-12 18:58 | 770K | |
![[ ]](/icons/layout.gif) | GXV3370 быстрый старт.pdf | 2019-04-15 14:08 | 8.9M | |
![[ ]](/icons/layout.gif) | GXV3370 техническое описание.pdf | 2019-04-15 14:05 | 1.7M | |
![[ ]](/icons/layout.gif) | GXW410x конфигурация с 3CX.pdf | 2019-03-19 15:48 | 973K | |
![[ ]](/icons/layout.gif) | GXW410x конфигурация с Asterisk.pdf | 2019-03-19 15:44 | 182K | |
![[ ]](/icons/layout.gif) | GXW410x руководство по быстрой установке.pdf | 2019-03-19 15:50 | 354K | |
![[ ]](/icons/layout.gif) | GXW4104, GXW4108 Grandstream техническая документация.pdf | 2019-03-19 15:40 | 486K | |
![[ ]](/icons/layout.gif) | GoIP руководство пользователя.pdf | 2019-04-11 13:09 | 1.9M | |
![[ ]](/icons/layout.gif) | H155A00.00B100_eng_tds.pdf | 2023-05-02 14:17 | 224K | |
![[ ]](/icons/layout.gif) | HCAAY-50-12 (1-2).pdf | 2024-01-09 21:57 | 72K | |
![[ ]](/icons/layout.gif) | HCTAY-50-22-7:8"-TECHNICAL-SPECIFICATION.pdf | 2025-02-19 22:37 | 190K | |
![[ ]](/icons/layout.gif) | HCTAYZ-50-2378A.pdf | 2023-07-18 15:28 | 183K | |
![[ ]](/icons/layout.gif) | HENGXIN-for RG58-connector-crimp-type.pdf | 2024-03-13 13:08 | 408K | |
![[ ]](/icons/layout.gif) | HF-SMA-02-141-TGG-27G.pdf | 2024-03-22 22:12 | 138K | |
![[ ]](/icons/layout.gif) | HT81x быстрый старт.pdf | 2019-04-16 17:20 | 413K | |
![[ ]](/icons/layout.gif) | HT801 быстрый старт.pdf | 2019-04-16 16:54 | 3.2M | |
![[ ]](/icons/layout.gif) | HT801 техническое описание.pdf | 2019-04-16 16:54 | 406K | |
![[ ]](/icons/layout.gif) | HT802 быстрый старт.pdf | 2019-04-16 17:06 | 4.1M | |
![[ ]](/icons/layout.gif) | HT802 техническое описание.pdf | 2019-04-16 17:06 | 646K | |
![[ ]](/icons/layout.gif) | HT812 техническое описание.pdf | 2019-04-16 17:20 | 574K | |
![[ ]](/icons/layout.gif) | HT813 техническое описание.pdf | 2019-04-16 17:31 | 1.5M | |
![[ ]](/icons/layout.gif) | HT814 техническое описание.pdf | 2019-04-16 18:13 | 603K | |
![[ ]](/icons/layout.gif) | HT818 техническое описание.pdf | 2019-04-16 17:27 | 560K | |
![[ ]](/icons/layout.gif) | HUAWEI Mobile Wifi Quick Start-(E5785-92c,01,EN-US).pdf | 2022-10-22 16:36 | 8.8M | |
![[ ]](/icons/layout.gif) | Hi10-3S-Pro-Datasheet-Updated2.pdf | 2024-07-04 00:45 | 1.2M | |
![[ ]](/icons/layout.gif) | Hi10-3S-Pro_EN-HiBoost-HomeOffice-User-Manual.pdf | 2024-07-04 00:46 | 1.9M | |
![[ ]](/icons/layout.gif) | Hi13-5S_Datasheet.pdf | 2022-10-12 13:48 | 589K | |
![[ ]](/icons/layout.gif) | Hi13-DCS_HiBoost_Datasheet.pdf | 2022-10-13 23:03 | 565K | |
![[ ]](/icons/layout.gif) | Hi17-5S_HiBoost_Datasheet.pdf | 2022-10-13 23:12 | 469K | |
![[ ]](/icons/layout.gif) | Hi20-3S_HiBoost_Datasheet.pdf | 2022-10-12 13:56 | 489K | |
![[ ]](/icons/layout.gif) | Hi20-5S_HiBoost_Datasheet.pdf | 2022-10-12 13:53 | 665K | |
![[ ]](/icons/layout.gif) | Hi20-6S-Plus-datasheet.pdf | 2023-01-31 16:52 | 516K | |
![[ ]](/icons/layout.gif) | Hi23-3S_HiBoost_Datasheet.pdf | 2022-10-12 13:50 | 377K | |
![[ ]](/icons/layout.gif) | Hi23-5S_HiBoost_Datasheet.pdf | 2022-10-12 13:55 | 526K | |
![[ ]](/icons/layout.gif) | Hi23-6S-Plus-manual.pdf | 2023-01-31 16:52 | 3.3M | |
![[ ]](/icons/layout.gif) | HiBoost-HomeOffice-User-Manual.pdf | 2022-10-13 23:06 | 6.6M | |
![[ ]](/icons/layout.gif) | HiBoost-Professional_User-Manual.pdf | 2022-10-12 13:52 | 6.4M | |
![[ ]](/icons/layout.gif) | Hiboost-HiWay-5S-EU-datasheet.pdf | 2022-09-27 19:38 | 1.4M | |
![[ ]](/icons/layout.gif) | Hiboost-Indoor-Panel-Antenna.pdf | 2023-02-09 21:16 | 273K | |
![[ ]](/icons/layout.gif) | Hiboost-Indoor-omni-antenna.pdf | 2023-02-09 21:22 | 455K | |
![[ ]](/icons/layout.gif) | Hiboost-Outdoor-directional-Antenna.pdf | 2023-02-09 21:24 | 350K | |
![[ ]](/icons/layout.gif) | Hiboost-Travel-4G-2.0-EN-user_manual.pdf | 2022-09-27 19:38 | 3.7M | |
![[ ]](/icons/layout.gif) | Hiboost-Updated-Outdoor-omni-antenna-E32090609001.pdf | 2023-02-09 21:18 | 576K | |
![[ ]](/icons/layout.gif) | Hiboost-outdoor-panel-antenna-new.pdf | 2023-02-09 21:13 | 423K | |
![[ ]](/icons/layout.gif) | Hiboost_Hi10-5S-datasheet.pdf | 2022-09-25 13:58 | 1.2M | |
![[ ]](/icons/layout.gif) | Hiboost_Hi10-EGSM-datasheet.pdf | 2022-09-25 14:02 | 589K | |
![[ ]](/icons/layout.gif) | Hiboost_Hi13-3S-datasheet.pdf | 2022-09-25 14:06 | 562K | |
![[ ]](/icons/layout.gif) | Hiboost_Hi13-5S-datasheet.pdf | 2022-09-25 14:08 | 589K | |
![[ ]](/icons/layout.gif) | Hiboost_Hi13-EGSM-datasheet.pdf | 2022-09-25 14:04 | 643K | |
![[ ]](/icons/layout.gif) | Hiboost_Hi13-EW_Datasheet.pdf | 2022-09-22 16:58 | 609K | |
![[ ]](/icons/layout.gif) | Hiboost_Hi17-3S-datasheet.pdf | 2022-09-26 13:56 | 758K | |
![[ ]](/icons/layout.gif) | Hub_инструкция_пользователя.pdf | 2019-07-05 10:35 | 1.1K | |
![[ ]](/icons/layout.gif) | Hub_Plus_инструкция_пользователя.pdf | 2019-07-05 11:08 | 1.1K | |
![[ ]](/icons/layout.gif) | Hyperflex 10 - Full Datasheet ENG.pdf | 2023-05-19 12:41 | 429K | |
![[ ]](/icons/layout.gif) | IO0727-03360 Omni Antenna.pdf | 2023-09-07 21:32 | 299K | |
![[ ]](/icons/layout.gif) | IP0727-0965 Panel Antenna.pdf | 2023-09-07 21:35 | 166K | |
![[ ]](/icons/layout.gif) | IP0760-0760-PCB-Antenna.pdf | 2024-08-02 22:01 | 191K | |
![[ ]](/icons/layout.gif) | IX140 быстрый старт.pdf | 2019-04-03 13:36 | 590K | |
![[ ]](/icons/layout.gif) | IX140 техническое описание.pdf | 2019-04-03 13:36 | 1.0M | |
![[ ]](/icons/layout.gif) | IX140 установка программного обеспечения IPPBX серии.pdf | 2019-04-03 13:36 | 644K | |
![[ ]](/icons/layout.gif) | IX240 техническое описание.pdf | 2019-04-12 19:54 | 1.0M | |
![[ ]](/icons/layout.gif) | Instructions for disassembling the cable under the connector RF N-type connector J01020A0127.pdf | 2023-07-09 23:44 | 61K | |
![[ ]](/icons/layout.gif) | J01010A0035KP.pdf | 2023-07-19 22:58 | 43K | |
![[ ]](/icons/layout.gif) | J01010A0035 assembly instruction.pdf | 2023-07-19 22:59 | 52K | |
![[ ]](/icons/layout.gif) | J01010A0049KP.pdf | 2023-07-15 00:02 | 57K | |
![[ ]](/icons/layout.gif) | J01010A2256 Assembly instruction.pdf | 2023-11-30 20:31 | 52K | |
![[ ]](/icons/layout.gif) | J01010A2256KP.pdf | 2023-11-30 20:31 | 40K | |
![[ ]](/icons/layout.gif) | J01011A0055KP.pdf | 2023-07-15 14:07 | 33K | |
![[ ]](/icons/layout.gif) | J01011A0055 assembly instruction.pdf | 2023-07-15 14:07 | 77K | |
![[ ]](/icons/layout.gif) | J01011B0046 Assembly instruction.pdf | 2023-12-01 00:00 | 62K | |
![[ ]](/icons/layout.gif) | J01011B0046KP.pdf | 2023-12-01 00:00 | 56K | |
![[ ]](/icons/layout.gif) | J01020A0035-assembly-instruction.pdf | 2024-03-30 16:37 | 82K | |
![[ ]](/icons/layout.gif) | J01020A0035KP.pdf | 2024-03-30 16:37 | 31K | |
![[ ]](/icons/layout.gif) | J01020A0119 assembly instruction.pdf | 2023-07-16 15:52 | 51K | |
![[ ]](/icons/layout.gif) | J01020A0119kp.pdf | 2023-07-16 15:51 | 25K | |
![[ ]](/icons/layout.gif) | J01020A0127-datasheet.pdf | 2023-07-09 23:44 | 244K | |
![[ ]](/icons/layout.gif) | J01020A0153 Assembly instruction.pdf | 2023-12-05 23:10 | 553K | |
![[ ]](/icons/layout.gif) | J01020A0153KP.pdf | 2023-12-05 23:10 | 67K | |
![[ ]](/icons/layout.gif) | J01020A0156_-_N_straight_plug_G37_2.77.25_-_Datasheet_Telegrtner.pdf | 2023-07-15 14:10 | 65K | |
![[ ]](/icons/layout.gif) | J01020A0168Kp.pdf | 2023-12-04 23:26 | 67K | |
![[ ]](/icons/layout.gif) | J01020A0184KP.pdf | 2023-12-01 20:17 | 63K | |
![[ ]](/icons/layout.gif) | J01020A0184 assembly instrution.pdf | 2023-12-01 20:17 | 68K | |
![[ ]](/icons/layout.gif) | J01020G0142.pdf | 2023-12-05 23:02 | 53K | |
![[ ]](/icons/layout.gif) | J01021A0155KP.pdf | 2023-07-14 23:23 | 67K | |
![[ ]](/icons/layout.gif) | J01021A0164-assembly-instruction.pdf | 2024-03-29 19:31 | 44K | |
![[ ]](/icons/layout.gif) | J01021A0164kp.pdf | 2024-03-29 19:31 | 60K | |
![[ ]](/icons/layout.gif) | J01021A0203 Assembly instruction.pdf | 2023-12-04 21:29 | 61K | |
![[ ]](/icons/layout.gif) | J01021A0203KP.pdf | 2023-12-04 21:29 | 73K | |
![[ ]](/icons/layout.gif) | J01021B0117Kp.pdf | 2023-07-16 15:22 | 28K | |
![[ ]](/icons/layout.gif) | J01021B0117 assembly instruction.pdf | 2023-07-16 15:23 | 49K | |
![[ ]](/icons/layout.gif) | J01021H0022-assembly-instruction.pdf | 2024-03-28 21:20 | 57K | |
![[ ]](/icons/layout.gif) | J01021H0022Kp.pdf | 2024-03-28 21:19 | 447K | |
![[ ]](/icons/layout.gif) | J01021H0096KP.pdf | 2023-11-20 11:55 | 431K | |
![[ ]](/icons/layout.gif) | J01021H0096 assembli instruction.pdf | 2023-11-20 11:55 | 58K | |
![[ ]](/icons/layout.gif) | J01021H1003 Assembly instruction.pdf | 2023-12-04 22:33 | 57K | |
![[ ]](/icons/layout.gif) | J01021H1003KP.pdf | 2023-12-04 22:33 | 447K | |
![[ ]](/icons/layout.gif) | J01021H1119-assembly-instruction.pdf | 2024-04-08 20:54 | 444K | |
![[ ]](/icons/layout.gif) | J01021H1119KP.pdf | 2024-04-08 20:54 | 432K | |
![[ ]](/icons/layout.gif) | J01024A0010KP.pdf | 2025-05-03 19:20 | 69K | |
![[ ]](/icons/layout.gif) | J01024J1094-datasheet.pdf | 2024-02-14 00:29 | 256K | |
![[ ]](/icons/layout.gif) | J01026A0020_-_N_Attenuator_m-f_10_dB_2_W_10_GHz_inner_conductor_gold_plated_-_Datasheet_Telegr.pdf | 2024-01-17 14:07 | 62K | |
![[ ]](/icons/layout.gif) | J01150A0011-assembly-instriction.pdf | 2024-04-06 23:40 | 66K | |
![[ ]](/icons/layout.gif) | J01150A0011KP.pdf | 2024-04-06 23:40 | 42K | |
![[ ]](/icons/layout.gif) | J01150A0049KP.pdf | 2023-11-20 20:47 | 40K | |
![[ ]](/icons/layout.gif) | J01150A0049 assembly instruction.pdf | 2023-11-20 20:47 | 66K | |
![[ ]](/icons/layout.gif) | J01150A0061-assembly instruction.pdf | 2024-05-09 13:34 | 51K | |
![[ ]](/icons/layout.gif) | J01150A0061KP.pdf | 2024-05-09 13:34 | 42K | |
![[ ]](/icons/layout.gif) | J01150A0091KP.pdf | 2023-11-23 21:56 | 44K | |
![[ ]](/icons/layout.gif) | J01150A0091 assembly instrution.pdf | 2023-11-23 21:56 | 51K | |
![[ ]](/icons/layout.gif) | J01150A0121 Assembly instruction.pdf | 2023-12-07 21:20 | 429K | |
![[ ]](/icons/layout.gif) | J01150A0121KP.pdf | 2023-12-07 21:20 | 48K | |
![[ ]](/icons/layout.gif) | J01150A0131 Assembly instruction.pdf | 2023-12-12 20:58 | 429K | |
![[ ]](/icons/layout.gif) | J01150A0131KP.pdf | 2023-12-12 20:58 | 44K | |
![[ ]](/icons/layout.gif) | J01150A0151 Assembly instruction.pdf | 2023-12-12 22:54 | 61K | |
![[ ]](/icons/layout.gif) | J01150A0151KP.pdf | 2023-12-12 22:54 | 36K | |
![[ ]](/icons/layout.gif) | J01150A0521KP.pdf | 2024-01-10 22:07 | 45K | |
![[ ]](/icons/layout.gif) | J01150A0521 assembly instruction.pdf | 2024-01-10 22:07 | 51K | |
![[ ]](/icons/layout.gif) | J01150A0588-assembly-instruction.pdf | 2024-03-21 12:21 | 69K | |
![[ ]](/icons/layout.gif) | J01150A0588Kp.pdf | 2024-03-21 12:21 | 34K | |
![[ ]](/icons/layout.gif) | J01150A0611Kp.pdf | 2023-07-16 16:05 | 32K | |
![[ ]](/icons/layout.gif) | J01150A0611 assembly instruction.pdf | 2023-07-16 16:05 | 64K | |
![[ ]](/icons/layout.gif) | J01150R0001-assembly-instruction.pdf | 2024-01-13 00:08 | 67K | |
![[ ]](/icons/layout.gif) | J01150R0001kp.pdf | 2024-01-13 00:08 | 40K | |
![[ ]](/icons/layout.gif) | J01150R0021 Assembly instruction.pdf | 2023-12-11 20:44 | 51K | |
![[ ]](/icons/layout.gif) | J01150R0021Kp.pdf | 2023-12-11 20:44 | 41K | |
![[ ]](/icons/layout.gif) | J01150R0051 assembly instruction.pdf | 2023-07-21 17:39 | 64K | |
![[ ]](/icons/layout.gif) | J01150R0051kp.pdf | 2023-07-21 17:39 | 41K | |
![[ ]](/icons/layout.gif) | J01151A0061 Assembly instruction.pdf | 2023-12-11 20:29 | 427K | |
![[ ]](/icons/layout.gif) | J01151A0061KP.pdf | 2023-12-11 20:29 | 29K | |
![[ ]](/icons/layout.gif) | J01151A0641KP.pdf | 2025-07-24 21:43 | 35K | |
![[ ]](/icons/layout.gif) | J01151A0911 Assembly instruction.pdf | 2024-01-11 21:50 | 427K | |
![[ ]](/icons/layout.gif) | J01151A0911KP.pdf | 2024-01-11 21:50 | 40K | |
![[ ]](/icons/layout.gif) | J01151A0931-mounting-dimentions.pdf | 2024-04-06 23:50 | 415K | |
![[ ]](/icons/layout.gif) | J01151A0931KP.pdf | 2024-04-06 23:50 | 33K | |
![[ ]](/icons/layout.gif) | J01151A1061Kp.pdf | 2023-07-16 16:14 | 60K | |
![[ ]](/icons/layout.gif) | J01151A1061 assembli instruction.pdf | 2023-07-16 16:14 | 64K | |
![[ ]](/icons/layout.gif) | J01151R0021-assembly-instruction.pdf | 2024-01-12 23:22 | 50K | |
![[ ]](/icons/layout.gif) | J01151R0021Kp.pdf | 2024-01-12 23:22 | 34K | |
![[ ]](/icons/layout.gif) | J01151R0051-assembly-instruction.pdf | 2024-03-23 12:30 | 64K | |
![[ ]](/icons/layout.gif) | J01151R0051kp.pdf | 2024-03-23 12:30 | 30K | |
![[ ]](/icons/layout.gif) | J01152A0011KP.pdf | 2024-04-07 00:08 | 40K | |
![[ ]](/icons/layout.gif) | J01340B0051 Assembly instruction.pdf | 2023-12-04 22:57 | 27K | |
![[ ]](/icons/layout.gif) | J01340B0051KP.pdf | 2023-12-04 22:57 | 63K | |
![[ ]](/icons/layout.gif) | Jabra_Biz2400 II_техническое_описание.pdf | 2019-10-08 16:08 | 1.5M | |
![[ ]](/icons/layout.gif) | KONA-Smart-Room-Sensor-Extended_техническое_описание.pdf | 2019-06-12 00:25 | 277K | |
![[ ]](/icons/layout.gif) | KS-8021-7DFB-PVC-RF400-COAXIAL-CABLE.pdf | 2024-03-08 23:18 | 207K | |
![[ ]](/icons/layout.gif) | KS-8195-LL195-RF195-COAXIAL-CABLE.pdf | 2024-03-09 00:08 | 296K | |
![[ ]](/icons/layout.gif) | KS-8402-RG402-RG402-COAXIAL-CABLE-Rev.A.pdf | 2024-03-08 23:49 | 244K | |
![[ ]](/icons/layout.gif) | KSR195-001-41010400051-PVC.pdf | 2024-04-04 00:28 | 784K | |
![[ ]](/icons/layout.gif) | KSR240-41010400238-PE-Coaxial-Cable-Specification-V1.0.pdf | 2025-05-19 23:42 | 808K | |
![[ ]](/icons/layout.gif) | KSR240-41010400340-Black-PVC-Coaxial-Cable-Specification-V1.0.pdf | 2024-08-23 22:07 | 810K | |
![[ ]](/icons/layout.gif) | KSR400-Olive-green-41010400362.pdf | 2025-09-29 00:05 | 239K | |
![[ ]](/icons/layout.gif) | KTR-250-50.pdf | 2025-02-01 23:56 | 543K | |
![[ ]](/icons/layout.gif) | Kingsignal-RG316-FEP.pdf | 2024-03-30 01:13 | 730K | |
![[ ]](/icons/layout.gif) | Kingsignal RG8 Cable.pdf | 2023-03-19 16:18 | 321K | |
![[ ]](/icons/layout.gif) | Kona-Industrial-Transceiver_техническое_описание.pdf | 2019-06-13 00:03 | 158K | |
![[ ]](/icons/layout.gif) | Kona-Mega_техническое_описание.pdf | 2019-06-07 10:21 | 394K | |
![[ ]](/icons/layout.gif) | Kona-Strand-II_техническое_описание.pdf | 2019-06-11 23:58 | 283K | |
![[ ]](/icons/layout.gif) | Kona_Macro_техническое_описание.pdf | 2019-06-07 10:07 | 318K | |
![[ ]](/icons/layout.gif) | Kona_Micro_техническое_описание.pdf | 2019-06-11 23:32 | 244K | |
![[ ]](/icons/layout.gif) | Kona_Mobile_техническое_описание.pdf | 2019-06-07 10:31 | 217K | |
![[ ]](/icons/layout.gif) | Kona_Pico_техническое_описание.pdf | 2019-06-11 23:38 | 180K | |
![[ ]](/icons/layout.gif) | Kona_Strand_техническое_описание.pdf | 2019-06-07 12:51 | 434K | |
![[ ]](/icons/layout.gif) | L01001B0007KP.pdf | 2023-11-07 20:40 | 58K | |
![[ ]](/icons/layout.gif) | L4PNM техническое описание.pdf | 2019-04-04 12:50 | 349K | |
![[ ]](/icons/layout.gif) | L33-B1B3B8 Tri band line amplifier.pdf | 2023-11-01 22:25 | 191K | |
![[ ]](/icons/layout.gif) | L33-B1B3B8 dual band line amplifier.pdf | 2023-11-01 22:24 | 191K | |
![[ ]](/icons/layout.gif) | L33-B1B3 User manual.pdf | 2022-12-06 00:05 | 1.9M | |
![[ ]](/icons/layout.gif) | L33-B1B3_user_manual.pdf | 2022-11-26 17:57 | 1.4M | |
![[ ]](/icons/layout.gif) | L33 User manual.pdf | 2022-11-26 18:03 | 1.7M | |
![[ ]](/icons/layout.gif) | L33_user_manual.pdf | 2022-09-30 13:34 | 1.4M | |
![[ ]](/icons/layout.gif) | LAPP-RG223-U.pdf | 2025-03-28 13:14 | 58K | |
![[ ]](/icons/layout.gif) | LC260 -TFLEX405.pdf | 2025-11-07 23:59 | 228K | |
![[ ]](/icons/layout.gif) | LMR-LW400.pdf | 2023-12-05 10:50 | 183K | |
![[ ]](/icons/layout.gif) | LibreVNA manual.pdf | 2023-09-08 00:10 | 3.0M | |
![[ ]](/icons/layout.gif) | LibreVNA specsheet.pdf | 2023-09-08 00:10 | 85K | |
![[ ]](/icons/layout.gif) | LinkOR 2GSM техническое описание.pdf | 2019-04-11 14:22 | 247K | |
![[ ]](/icons/layout.gif) | LiteVNA-User-Guide.pdf | 2024-03-29 23:41 | 1.1M | |
![[ ]](/icons/layout.gif) | LiteVNA Menu Structure Map-1.2.pdf | 2023-07-14 12:23 | 253K | |
![[ ]](/icons/layout.gif) | LiteVNA_User-Guide.pdf | 2024-03-29 23:39 | 1.1M | |
![[ ]](/icons/layout.gif) | MA-N-100-XX-attenuator.pdf | 2025-08-13 23:27 | 264K | |
![[ ]](/icons/layout.gif) | MC52iT iRZ руководство пользователя.pdf | 2019-03-20 17:12 | 564K | |
![[ ]](/icons/layout.gif) | MC52iT iRZ справочник IT команд (BGS2).pdf | 2019-03-20 17:12 | 2.6M | |
![[ ]](/icons/layout.gif) | MC52iT iRZ температурные испытания.pdf | 2019-03-20 17:12 | 129K | |
![[ ]](/icons/layout.gif) | MC52iT iRZ техническое описание.pdf | 2019-03-20 17:12 | 1.5M | |
![[ ]](/icons/layout.gif) | MF920U Quick Start Guide.pdf | 2022-10-22 15:58 | 215K | |
![[ ]](/icons/layout.gif) | MMCX-01L-TGG.pdf | 2024-04-18 10:57 | 145K | |
![[ ]](/icons/layout.gif) | MV-374, MV-378 подробное описание.pdf | 2019-04-11 16:28 | 3.4M | |
![[ ]](/icons/layout.gif) | Maxflex141-41010700005.pdf | 2025-02-20 23:01 | 124K | |
![[ ]](/icons/layout.gif) | MeP-HYF13-CABLES-FULL-LIST--MP-HYPERFLEAll6_EN.pdf | 2023-06-02 23:56 | 402K | |
![[ ]](/icons/compressed.gif) | MilesightVPN v2.0.2 for Ubuntu 20.04 SOFTWARE.zip | 2023-01-24 21:40 | 52M | |
![[ ]](/icons/layout.gif) | Mobile-SMA-Antenna-003R-00225_техническое_описание.pdf | 2020-05-20 22:46 | 211K | |
![[ ]](/icons/layout.gif) | MotionProtect_инструкция_пользователя.pdf | 2019-07-05 13:01 | 1.1K | |
![[ ]](/icons/layout.gif) | MotionProtect_Plus_инструкция_пользователя.pdf | 2019-07-06 10:42 | 1.1K | |
![[ ]](/icons/layout.gif) | N-01T-TGN.pdf | 2024-07-28 23:44 | 177K | |
![[ ]](/icons/layout.gif) | N-04B-TGN.pdf | 2024-03-25 21:04 | 145K | |
![[ ]](/icons/layout.gif) | N-04F-7-TGN.pdf | 2024-11-11 01:11 | 165K | |
![[ ]](/icons/layout.gif) | N-04LM-1-TGN.pdf | 2025-05-18 23:01 | 170K | |
![[ ]](/icons/layout.gif) | N-04LM-E-TGN.pdf | 2024-07-19 17:59 | 168K | |
![[ ]](/icons/layout.gif) | N-04T-TGN.pdf | 2024-07-18 00:48 | 164K | |
![[ ]](/icons/layout.gif) | N-05F-1-TGN.pdf | 2024-04-25 21:46 | 134K | |
![[ ]](/icons/layout.gif) | N-05F-2-TGN.pdf | 2024-07-10 00:09 | 151K | |
![[ ]](/icons/layout.gif) | N-05F-3-TGN.pdf | 2024-11-15 22:16 | 151K | |
![[ ]](/icons/layout.gif) | N-05LM-3-TGN.pdf | 2024-08-27 00:41 | 152K | |
![[ ]](/icons/layout.gif) | N-05T-E-TGN.pdf | 2024-08-27 23:36 | 148K | |
![[ ]](/icons/layout.gif) | N-08-TGN.pdf | 2024-08-22 22:08 | 142K | |
![[ ]](/icons/layout.gif) | N-09-1-TGN.pdf | 2025-05-18 23:30 | 128K | |
![[ ]](/icons/layout.gif) | N-17-2-4-TGN.pdf | 2025-05-13 00:21 | 555K | |
![[ ]](/icons/layout.gif) | N-19-141-TGN.pdf | 2024-11-12 23:46 | 162K | |
![[ ]](/icons/layout.gif) | N-20F-2-TGN-12G.pdf | 2024-11-19 22:20 | 171K | |
![[ ]](/icons/layout.gif) | N-20L-2-TGN.pdf | 2024-11-19 23:14 | 175K | |
![[ ]](/icons/layout.gif) | N-33-3-4-TGN.pdf | 2025-05-07 18:57 | 150K | |
![[ ]](/icons/layout.gif) | N-37LM-3-TGN.pdf | 2024-11-17 12:39 | 172K | |
![[ ]](/icons/layout.gif) | N-37T-3-TGN.pdf | 2024-11-10 22:22 | 172K | |
![[ ]](/icons/layout.gif) | N-38-141-TGN.pdf | 2024-07-09 23:13 | 153K | |
![[ ]](/icons/layout.gif) | N-38F-2-TGN.pdf | 2024-07-10 00:45 | 158K | |
![[ ]](/icons/layout.gif) | N-38L-1-TGN.pdf | 2024-07-09 23:45 | 163K | |
![[ ]](/icons/layout.gif) | N-38M-1-TGN.pdf | 2025-05-18 23:40 | 172K | |
![[ ]](/icons/layout.gif) | N-43-141-1-TGN-18G.pdf | 2024-03-22 23:30 | 137K | |
![[ ]](/icons/layout.gif) | N-50W-attenuator-SAT-50W-06-N.pdf | 2025-03-09 23:20 | 222K | |
![[ ]](/icons/layout.gif) | N-C400P-Data-Sheet.pdf | 2024-01-04 20:15 | 101K | |
![[ ]](/icons/layout.gif) | N-Female-Flange-connector-for-RG402-RF-cable-Model-FN-F-402.pdf | 2024-08-22 11:45 | 153K | |
![[ ]](/icons/layout.gif) | N-Male-connector-for 1-2 -Superflex-RF-cable.pdf | 2024-08-22 21:40 | 222K | |
![[ ]](/icons/layout.gif) | NF-KSR195-Crimp-installation-Instruction.pdf | 2025-05-21 00:33 | 101K | |
![[ ]](/icons/layout.gif) | NF-KSR400-Crimp-installation-Instruction.pdf | 2025-05-22 01:16 | 101K | |
![[ ]](/icons/layout.gif) | NF-KSR400-Crimp installation Instruction.pdf | 2025-05-22 01:16 | 101K | |
![[ ]](/icons/layout.gif) | NM-1-2L-installation-Instruction.pdf | 2025-05-27 00:45 | 2.0M | |
![[ ]](/icons/unknown.gif) | NM-1-2S-installation-Instruction.PDF | 2025-05-20 23:53 | 6.4M | |
![[ ]](/icons/layout.gif) | NM-1-2S-installation-Instruction.pdf | 2025-05-20 23:57 | 1.2M | |
![[ ]](/icons/unknown.gif) | NM-1-2S installation Instruction.PDF | 2025-05-20 23:52 | 6.4M | |
![[ ]](/icons/layout.gif) | NM-7-8L-installation-Instruction.pdf | 2025-05-21 00:06 | 3.6M | |
![[ ]](/icons/layout.gif) | NM-KSR195-Crimp-Specification-45010203962.pdf | 2025-07-04 22:26 | 153K | |
![[ ]](/icons/layout.gif) | NM-KSR195-Crimp-installation-Instruction.pdf | 2025-07-04 22:48 | 101K | |
![[ ]](/icons/layout.gif) | NM-KSR195-Specification-45010203962.pdf | 2025-07-04 22:28 | 153K | |
![[ ]](/icons/layout.gif) | NM-KSR240-Crimp-installation-Instruction.pdf | 2025-08-11 13:57 | 101K | |
![[ ]](/icons/layout.gif) | NM-KSR240_Technical_Description.pdf | 2025-05-27 21:52 | 23K | |
![[ ]](/icons/layout.gif) | NM-KSR300 Specification.pdf | 2023-12-24 17:47 | 239K | |
![[ ]](/icons/layout.gif) | NM-KSR300-installation-Instruction.pdf | 2025-03-18 23:31 | 125K | |
![[ ]](/icons/layout.gif) | NM-KSR400-clamp-Specification-kingsignal.pdf | 2025-02-21 18:02 | 106K | |
![[ ]](/icons/layout.gif) | NM-KSR400-clamp-Specification.pdf | 2024-12-05 00:23 | 98K | |
![[ ]](/icons/layout.gif) | NM-KSR400-clamp-installation-Instruction.pdf | 2024-12-13 15:10 | 1.1M | |
![[ ]](/icons/layout.gif) | NM-KSR400-crimp-Specification.pdf | 2024-11-11 23:59 | 102K | |
![[ ]](/icons/layout.gif) | NM-KSR400-crimp-installation-Instruction.pdf | 2025-01-10 10:47 | 124K | |
![[ ]](/icons/layout.gif) | NM-KSR500-clamp-Specification.pdf | 2024-12-13 00:16 | 99K | |
![[ ]](/icons/layout.gif) | NM-KSR500-installation-Instruction.pdf | 2025-03-25 14:54 | 1.1M | |
![[ ]](/icons/unknown.gif) | NM-KSR600-Installation-Instruction.PDF | 2025-09-01 13:27 | 5.1M | |
![[ ]](/icons/layout.gif) | NM-KSR600-Installation-Instruction.pdf | 2025-09-01 13:30 | 5.1M | |
![[IMG]](/icons/image2.gif) | NM-LMR400-10.jpg | 2024-01-19 14:49 | 92K | |
![[ ]](/icons/layout.gif) | NM-LMR400-Assembly-instruction.pdf | 2024-01-19 14:49 | 96K | |
![[ ]](/icons/layout.gif) | OO0825-05360-Omni-Antenna.pdf | 2024-09-03 17:23 | 3.3M | |
![[ ]](/icons/layout.gif) | OP0727-0865 Outdoor Panel Antenna.pdf | 2023-09-07 21:44 | 145K | |
![[ ]](/icons/layout.gif) | OY0727-0965 Log Periodic Antenna.pdf | 2023-09-07 21:47 | 375K | |
![[ ]](/icons/layout.gif) | OpenVox GSM:3G быстрый старт с системой 3CX.pdf | 2019-04-11 14:10 | 1.0M | |
![[ ]](/icons/layout.gif) | OpenVox GSM:3G быстрый старт с системой Asterisk.pdf | 2019-04-11 14:10 | 754K | |
![[ ]](/icons/layout.gif) | OpenVox GSM:3G быстрый старт с системой Elastix.pdf | 2019-04-11 14:10 | 731K | |
![[ ]](/icons/layout.gif) | OpenVox GSM:3G быстрый старт с системой FreeSWITCH.pdf | 2019-04-11 14:10 | 741K | |
![[ ]](/icons/layout.gif) | OpenVox GSM:3G быстрый старт с системой VOS3000 Operation Platform.pdf | 2019-04-11 14:10 | 2.7M | |
![[ ]](/icons/layout.gif) | OpenVox GSM:3G инструкция пользователя.pdf | 2019-04-11 14:10 | 3.4M | |
![[ ]](/icons/layout.gif) | OpenVox GSM:3G техническое описание.pdf | 2019-04-11 14:10 | 619K | |
![[ ]](/icons/layout.gif) | PPC-3100S_datasheet.pdf | 2022-10-08 14:48 | 434K | |
![[ ]](/icons/layout.gif) | PPC-3100_datasheet.pdf | 2022-10-09 13:10 | 376K | |
![[ ]](/icons/layout.gif) | PPC-3120S_datasheet.pdf | 2022-10-08 13:30 | 379K | |
![[ ]](/icons/layout.gif) | PPC-3150S_datasheet.pdf | 2022-10-08 00:08 | 422K | |
![[ ]](/icons/layout.gif) | PPC-3150_datasheet.pdf | 2022-10-07 23:52 | 399K | |
![[ ]](/icons/layout.gif) | PPC-3170_datasheet.pdf | 2022-10-09 13:23 | 391K | |
![[ ]](/icons/layout.gif) | PPC-3190_datasheet.pdf | 2022-10-09 12:36 | 403K | |
![[ ]](/icons/layout.gif) | PicoCell 900SXB инструкция по эксплуатации.pdf | 2019-03-19 15:20 | 459K | |
![[ ]](/icons/layout.gif) | PicoCell 2000SXB инструкция по эксплуатации.pdf | 2019-03-20 11:43 | 439K | |
![[ ]](/icons/layout.gif) | PicoCell_900|1800SXA_техническое_описание.pdf | 2019-06-07 20:06 | 399K | |
![[ ]](/icons/layout.gif) | Power-cable-with-4-way-screw-terminal-058R-00229-v1.2_техническое_описание.pdf | 2020-05-20 23:06 | 144K | |
![[ ]](/icons/layout.gif) | Product_Brochure_Cables_T00013A0203.pdf | 2023-06-21 00:07 | 925K | |
![[ ]](/icons/layout.gif) | Product_Brochure_for_Low_Loss_Cables_T00013A0319.pdf | 2023-06-21 00:07 | 7.6M | |
![[ ]](/icons/layout.gif) | R0_Установочный_чертеж.pdf | 2019-07-23 22:21 | 42K | |
![[ ]](/icons/layout.gif) | R0_wifi_Руководство_пользователя.pdf | 2020-03-23 12:27 | 676K | |
![[ ]](/icons/layout.gif) | R01w (RL01w, RU01w)_руководство_пользователя.pdf | 2019-07-23 22:21 | 901K | |
![[ ]](/icons/layout.gif) | R4X руководство пользователя.pdf | 2019-04-23 13:30 | 959K | |
![[ ]](/icons/layout.gif) | R4X wifi инструкция пользователя.pdf | 2019-04-23 13:55 | 1.0M | |
![[ ]](/icons/layout.gif) | R311A_инструкция_пользователя.pdf | 2019-06-08 01:24 | 1.9M | |
![[ ]](/icons/layout.gif) | R311A_техническое_описание.pdf | 2019-06-08 01:24 | 302K | |
![[ ]](/icons/layout.gif) | R718CK_техническое_описание.pdf | 2019-06-08 15:51 | 186K | |
![[ ]](/icons/layout.gif) | R718PB13_инструкция_пользователя.pdf | 2019-06-08 17:13 | 205K | |
![[ ]](/icons/layout.gif) | R718PB13_техническое_описание.pdf | 2019-06-08 17:13 | 170K | |
![[ ]](/icons/layout.gif) | R718PB14_инструкция_пользователя.pdf | 2019-06-08 16:31 | 181K | |
![[ ]](/icons/layout.gif) | R718PB14_техническое_описание.pdf | 2019-06-08 16:31 | 381K | |
![[ ]](/icons/layout.gif) | R718T2_инструкция_пользователя.pdf | 2019-06-08 00:12 | 206K | |
![[ ]](/icons/layout.gif) | R718T2_техническое_описание.pdf | 2019-06-08 00:12 | 194K | |
![[ ]](/icons/layout.gif) | R72623_инструкция_пользователя.pdf | 2019-06-08 00:41 | 459K | |
![[ ]](/icons/layout.gif) | R72623_техническое_описание.pdf | 2019-06-08 00:41 | 213K | |
![[ ]](/icons/layout.gif) | RA0708_инструкция_пользователя.pdf | 2019-06-08 14:16 | 468K | |
![[ ]](/icons/layout.gif) | RA0708_технические_характеристики.pdf | 2019-06-08 14:16 | 184K | |
![[ ]](/icons/layout.gif) | RA0713_инструкция_пользователя.pdf | 2019-06-08 13:44 | 468K | |
![[ ]](/icons/layout.gif) | RA0713_техническое_описание.pdf | 2019-06-08 13:44 | 251K | |
![[ ]](/icons/layout.gif) | RA0715_инструкция_пользователя.pdf | 2019-06-08 01:10 | 468K | |
![[ ]](/icons/layout.gif) | RA0715_техническое_описание.pdf | 2019-06-08 01:10 | 259K | |
![[ ]](/icons/layout.gif) | RA0716_инструкция_пользователя.pdf | 2019-06-08 13:31 | 468K | |
![[ ]](/icons/layout.gif) | RA0716_техническое_описание.pdf | 2019-06-08 13:31 | 277K | |
![[ ]](/icons/layout.gif) | RB4011-IN_брошюра.pdf | 2019-06-16 17:57 | 1.7M | |
![[ ]](/icons/layout.gif) | RETURN-to-SHOP-GSM.UA.pdf | 2022-09-27 17:20 | 56K | |
![[ ]](/icons/layout.gif) | RFA 1:2" DataSheet.pdf | 2023-12-05 22:43 | 261K | |
![[ ]](/icons/layout.gif) | RFA 7:8" DataSheet.pdf | 2023-12-05 22:41 | 267K | |
![[ ]](/icons/layout.gif) | RG-8-Hengxin-Technology.pdf | 2023-05-26 21:40 | 175K | |
![[ ]](/icons/layout.gif) | RG-213.pdf | 2023-05-10 19:21 | 163K | |
![[ ]](/icons/layout.gif) | RG58-008(41010600024) Coaxial Cable Specification V1.0_1.pdf | 2024-01-19 21:56 | 868K | |
![[ ]](/icons/layout.gif) | RG142-FEP-V1.0-41010600064-67.pdf | 2024-11-07 22:01 | 707K | |
![[ ]](/icons/layout.gif) | RG178-FEP-V1.0-41010600069-70-95.pdf | 2024-11-06 23:29 | 644K | |
![[ ]](/icons/layout.gif) | RG223-Kingsignal-Data-Sheet.pdf | 2023-12-24 19:25 | 871K | |
![[ ]](/icons/layout.gif) | RG400-FEP-Base-Station-RF-Traxial-Cable-V1.041010600087.pdf | 2024-08-15 16:00 | 889K | |
![[ ]](/icons/layout.gif) | RL01_Техническое_описание.pdf | 2020-12-03 13:18 | 371K | |
![[ ]](/icons/layout.gif) | RL01_RU01_Инструкция_пользователя.pdf | 2020-12-03 13:20 | 730K | |
![[ ]](/icons/layout.gif) | RL01w_ техническое_описание.pdf | 2019-07-23 22:21 | 1.8M | |
![[ ]](/icons/layout.gif) | RL21l iRZ Техническое описание.pdf | 2020-12-17 13:17 | 948K | |
![[ ]](/icons/layout.gif) | RL21w_Техническое_описание.pdf | 2020-11-06 10:54 | 540K | |
![[ ]](/icons/layout.gif) | RL25w_Руководство_пользователя.pdf | 2020-11-06 10:47 | 1.3M | |
![[ ]](/icons/layout.gif) | RL25w_Техническое_описание.pdf | 2020-11-06 10:47 | 482K | |
![[ ]](/icons/layout.gif) | RL41l техническое описание.pdf | 2019-04-23 13:30 | 2.1M | |
![[ ]](/icons/layout.gif) | RMS-Brochure-ru.pdf | 2019-09-17 20:19 | 1.3M | |
![[ ]](/icons/layout.gif) | ROAM-R41_Quick-Start-Guide.pdf | 2023-08-22 21:29 | 1.1M | |
![[ ]](/icons/layout.gif) | RP-SMAM-KSR-195-Crimp-installation-Instruction-V2.pdf | 2025-08-21 18:45 | 128K | |
![[ ]](/icons/layout.gif) | RP-SMAM-KSR-195-Crimp-installation-Instruction.pdf | 2025-07-19 20:37 | 126K | |
![[ ]](/icons/layout.gif) | RP-SMAM-KSR195-Crimp-installation-Instruction.pdf | 2025-07-19 20:13 | 100K | |
![[ ]](/icons/layout.gif) | RP-SMAM-KSR240-Crimp-installation-Instruction.pdf | 2025-05-21 00:52 | 101K | |
![[ ]](/icons/layout.gif) | RP-SMAM-KSR240-Crimp installation Instruction.pdf | 2025-05-27 21:47 | 100K | |
![[ ]](/icons/layout.gif) | RT600 RTU Datasheet.pdf | 2022-11-26 00:09 | 3.5M | |
![[ ]](/icons/layout.gif) | RT620 Datasheet.pdf | 2022-11-25 23:35 | 958K | |
![[ ]](/icons/layout.gif) | RT620 Quick Guide.pdf | 2022-11-25 23:35 | 595K | |
![[ ]](/icons/layout.gif) | RU01_Техническое_описание.pdf | 2020-12-03 13:25 | 368K | |
![[ ]](/icons/layout.gif) | RU01w_Техническое_Описание.pdf | 2020-03-23 12:27 | 378K | |
![[ ]](/icons/layout.gif) | RU21 техническое описание.pdf | 2019-04-23 14:07 | 1.6M | |
![[ ]](/icons/layout.gif) | RU21, RL21 руководство пользователя.pdf | 2019-04-23 14:07 | 778K | |
![[ ]](/icons/layout.gif) | RU41 техническое описание.pdf | 2019-04-23 14:04 | 2.1M | |
![[ ]](/icons/layout.gif) | RU41u техническое описание.pdf | 2019-04-23 13:51 | 2.2M | |
![[ ]](/icons/layout.gif) | RU41w техническое описание.pdf | 2019-04-23 13:55 | 2.2M | |
![[ ]](/icons/compressed.gif) | RUT2XX_R_00.01.06.1_WEBUI Firmware.bin.zip | 2019-04-02 12:47 | 11M | |
![[ ]](/icons/layout.gif) | RUT200_Datasheet-v1.2.pdf | 2022-12-02 14:27 | 1.2M | |
![[ ]](/icons/layout.gif) | RUT200_Flyer-v1.2.pdf | 2022-12-02 14:27 | 891K | |
![[ ]](/icons/layout.gif) | RUT230 краткое руководство пользователя.pdf | 2019-03-21 19:13 | 2.8M | |
![[ ]](/icons/layout.gif) | RUT230 техническое описание.pdf | 2019-03-21 19:13 | 2.6M | |
![[ ]](/icons/layout.gif) | RUT240 быстрый старт.pdf | 2019-04-02 12:45 | 2.9M | |
![[ ]](/icons/layout.gif) | RUT240 руководство пользователя.pdf | 2019-04-02 12:45 | 5.2M | |
![[ ]](/icons/layout.gif) | RUT240 техническое описание.pdf | 2019-04-02 12:45 | 2.5M | |
![[ ]](/icons/layout.gif) | RUT360_Инструкция пользователя.pdf | 2021-02-11 10:20 | 348K | |
![[ ]](/icons/layout.gif) | RUT360_Техническое описание.pdf | 2021-02-11 10:20 | 1.3M | |
![[ ]](/icons/layout.gif) | RUT850 краткое руководство пользователя.pdf | 2019-03-21 19:11 | 3.1M | |
![[ ]](/icons/layout.gif) | RUT850 техническое описание.pdf | 2019-03-21 19:11 | 1.6M | |
![[ ]](/icons/layout.gif) | RUT900 быстрый старт.pdf | 2019-03-27 22:12 | 1.5M | |
![[ ]](/icons/layout.gif) | RUT900 техническое описание.pdf | 2019-03-27 22:12 | 794K | |
![[ ]](/icons/layout.gif) | RUT950 быстрый старт.pdf | 2019-04-11 11:14 | 1.5M | |
![[ ]](/icons/layout.gif) | RUT950 руководство пользователя.pdf | 2019-04-11 11:14 | 6.7M | |
![[ ]](/icons/layout.gif) | RUT950 техническое описание.pdf | 2019-04-11 11:14 | 822K | |
![[ ]](/icons/layout.gif) | RUT955 быстрый старт.pdf | 2019-04-11 11:20 | 1.5M | |
![[ ]](/icons/layout.gif) | RUT955 инструкция пользователя.pdf | 2019-04-11 11:19 | 930K | |
![[ ]](/icons/layout.gif) | RUT955 техническое описание.pdf | 2019-04-11 11:20 | 837K | |
![[ ]](/icons/layout.gif) | RUTX08 руководство пользователя.pdf | 2019-03-27 21:43 | 1.4M | |
![[ ]](/icons/layout.gif) | RUTX08 техническое описание.pdf | 2019-03-27 21:43 | 807K | |
![[ ]](/icons/layout.gif) | RUTX09 инструкция пользователя.pdf | 2019-03-27 21:03 | 1.5M | |
![[ ]](/icons/layout.gif) | RUTX09 техническое описание.pdf | 2019-03-27 21:03 | 846K | |
![[ ]](/icons/layout.gif) | RUTX10 Инструкция пользователя.pdf | 2021-02-22 23:38 | 254K | |
![[ ]](/icons/layout.gif) | RUTX10 Техническое описание.pdf | 2021-02-22 23:38 | 1.3M | |
![[ ]](/icons/layout.gif) | RUTX11_быстрый_старт.pdf | 2019-06-07 00:53 | 1.5M | |
![[ ]](/icons/layout.gif) | RUTX11_инструкция_пользователя.pdf | 2019-06-07 00:53 | 1.7M | |
![[ ]](/icons/layout.gif) | RUTX11_техническое_описание.pdf | 2019-06-07 00:53 | 841K | |
![[ ]](/icons/layout.gif) | RUTX12_инструкция_пользователя.pdf | 2020-06-05 15:58 | 272K | |
![[ ]](/icons/layout.gif) | RUTX12_техническое_описание.pdf | 2020-06-05 15:58 | 2.7M | |
![[ ]](/icons/layout.gif) | RUTXR1_Техническое_описание.pdf | 2020-11-27 13:06 | 1.6M | |
![[ ]](/icons/layout.gif) | ReX_инструкция_пользователя.pdf | 2019-07-05 10:54 | 1.1K | |
![[ ]](/icons/layout.gif) | RigExpert© FOBOS SDR Receiver Datasheet rev.2.0.pdf | 2024-04-17 21:50 | 739K | |
![[ ]](/icons/layout.gif) | S20T-EDW triple band Digital Repeater.pdf | 2022-11-26 17:40 | 251K | |
![[ ]](/icons/layout.gif) | S20T Series Dual Band Digital Repeater.pdf | 2022-11-26 17:43 | 246K | |
![[ ]](/icons/layout.gif) | SBC30 CarpeStar техническое описание.pdf | 2019-03-27 16:51 | 602K | |
![[ ]](/icons/layout.gif) | SCF12-50J.pdf | 2023-04-17 16:26 | 310K | |
![[ ]](/icons/compressed.gif) | SDK Telit для Python 1.5.2.zip | 2019-03-20 17:31 | 6.7M | |
![[ ]](/icons/layout.gif) | SHA850A_DataSheet_EN02B.pdf | 2024-03-13 21:53 | 1.5M | |
![[ ]](/icons/layout.gif) | SIMBANK CarpeStar техническое описание.pdf | 2019-03-27 11:58 | 389K | |
![[ ]](/icons/layout.gif) | SIP-T5 серия, CP960 руководство администратора.pdf | 2019-04-16 14:59 | 20M | |
![[ ]](/icons/layout.gif) | SIP-T58V, T58A инструкция пользователя.pdf | 2019-04-16 14:59 | 25M | |
![[ ]](/icons/layout.gif) | SIRIO-SLP-4G-LTE-datasheet.pdf | 2023-02-13 14:27 | 1.3M | |
![[ ]](/icons/layout.gif) | SMA-01F-TGG.pdf | 2024-04-27 00:25 | 153K | |
![[ ]](/icons/layout.gif) | SMA-01L-RP-TGG.pdf | 2024-04-28 16:38 | 154K | |
![[ ]](/icons/layout.gif) | SMA-01L-TGG.pdf | 2024-04-19 23:17 | 153K | |
![[ ]](/icons/layout.gif) | SMA-01LM-3-TGG.pdf | 2024-12-30 13:31 | 173K | |
![[ ]](/icons/layout.gif) | SMA-01LM-S2-TGG.pdf | 2024-04-18 00:02 | 158K | |
![[ ]](/icons/layout.gif) | SMA-01M-TGG.pdf | 2025-05-19 00:08 | 162K | |
![[ ]](/icons/layout.gif) | SMA-02F-RP-TGG.pdf | 2024-07-24 00:05 | 162K | |
![[ ]](/icons/layout.gif) | SMA-02F-TGG.pdf | 2024-04-20 15:21 | 145K | |
![[ ]](/icons/layout.gif) | SMA-02L-RP-TGG.pdf | 2024-04-29 22:43 | 146K | |
![[ ]](/icons/layout.gif) | SMA-02L-TGG.pdf | 2024-04-20 12:08 | 144K | |
![[ ]](/icons/layout.gif) | SMA-02LM-S2-RP-TGG.pdf | 2024-11-20 00:07 | 173K | |
![[ ]](/icons/layout.gif) | SMA-02LM-S4-TGG.pdf | 2024-03-25 21:53 | 141K | |
![[ ]](/icons/layout.gif) | SMA-02M-1-TGG.pdf | 2025-05-19 00:20 | 165K | |
![[ ]](/icons/layout.gif) | SMA-02T-S1-TGG.pdf | 2024-07-18 01:28 | 162K | |
![[ ]](/icons/layout.gif) | SMA-03F-RP-TGG.pdf | 2024-08-17 13:27 | 155K | |
![[ ]](/icons/layout.gif) | SMA-03F-TGG.pdf | 2024-08-05 22:59 | 147K | |
![[ ]](/icons/layout.gif) | SMA-03L-1-TGG.pdf | 2024-08-28 21:04 | 148K | |
![[ ]](/icons/layout.gif) | SMA-03LM-2-TGG.pdf | 2024-08-26 00:42 | 149K | |
![[ ]](/icons/layout.gif) | SMA-09-TGN.pdf | 2024-08-30 23:21 | 156K | |
![[ ]](/icons/layout.gif) | SMA-2W-attenuator.pdf | 2025-07-20 17:59 | 252K | |
![[ ]](/icons/layout.gif) | SMA-10-S2-TGN.pdf | 2024-08-28 22:44 | 152K | |
![[ ]](/icons/layout.gif) | SMA-15F-TGG.pdf | 2025-05-19 22:35 | 167K | |
![[ ]](/icons/layout.gif) | SMA-15L-TGG.pdf | 2024-11-19 23:57 | 166K | |
![[ ]](/icons/layout.gif) | SMA-15LM-TGG.pdf | 2025-05-13 23:36 | 164K | |
![[ ]](/icons/layout.gif) | SMA-15M-TGG.pdf | 2025-05-13 23:11 | 163K | |
![[ ]](/icons/layout.gif) | SMA-19-S1-TGG.pdf | 2024-11-22 23:41 | 145K | |
![[ ]](/icons/layout.gif) | SMA-21-TGN.pdf | 2024-08-28 23:02 | 136K | |
![[ ]](/icons/layout.gif) | SMA-25-141-TGG.pdf | 2024-03-22 22:07 | 134K | |
![[ ]](/icons/layout.gif) | SMA-27-141-TGG.pdf | 2024-03-22 22:33 | 142K | |
![[ ]](/icons/layout.gif) | SMA-32L-9-TGG.pdf | 2024-11-20 00:29 | 169K | |
![[ ]](/icons/layout.gif) | SMA-35F-TGG.pdf | 2024-05-01 23:06 | 140K | |
![[ ]](/icons/layout.gif) | SMA-35L-TGG.pdf | 2024-05-05 00:39 | 141K | |
![[ ]](/icons/layout.gif) | SMA-37-2-TGG.pdf | 2024-11-17 14:32 | 136K | |
![[ ]](/icons/layout.gif) | SMA-42-S1-TGN.pdf | 2024-08-30 23:41 | 167K | |
![[ ]](/icons/layout.gif) | SMA-57-141-RP-TGG.pdf | 2024-04-29 23:39 | 122K | |
![[ ]](/icons/layout.gif) | SMA-57-141-TGG.pdf | 2024-03-22 22:48 | 120K | |
![[ ]](/icons/layout.gif) | SMA-C174P-datasheet.pdf | 2024-01-17 21:22 | 84K | |
![[ ]](/icons/layout.gif) | SMA-JACK-TO-UFL-FOR-1.37-CABLE.pdf | 2025-08-08 00:51 | 448K | |
![[ ]](/icons/layout.gif) | SMA-Male-connector-for-RG402-RF-cable-Model-SMA-M-402.pdf | 2024-07-26 00:30 | 150K | |
![[ ]](/icons/layout.gif) | SMA-S240J-datasheet.pdf | 2024-04-25 00:37 | 335K | |
![[ ]](/icons/layout.gif) | SMA-S402J-datasheet.pdf | 2024-01-19 22:32 | 262K | |
![[ ]](/icons/layout.gif) | SMA-S402P-assembli-instruction.pdf | 2024-01-19 23:02 | 490K | |
![[ ]](/icons/layout.gif) | SMA-S402P-datasheet.pdf | 2024-01-19 23:02 | 195K | |
![[ ]](/icons/layout.gif) | SMAM-670-141-installation-instruction.pdf | 2024-12-10 22:18 | 561K | |
![[ ]](/icons/layout.gif) | SMAM-KSR195-installation-Instruction.pdf | 2024-12-11 12:23 | 594K | |
![[ ]](/icons/layout.gif) | SMAM-KSR240-Crimp-installation-Instruction.pdf | 2025-05-22 00:48 | 100K | |
![[ ]](/icons/layout.gif) | SMAMRA-KSR195-Specification-Kingsignal.pdf | 2025-02-21 23:15 | 104K | |
![[ ]](/icons/layout.gif) | SMAMRA-KSR195-Specification.pdf | 2024-12-11 23:09 | 92K | |
![[ ]](/icons/layout.gif) | SMAMRA-KSR195-installation-Instruction.pdf | 2025-01-03 16:21 | 935K | |
![[ ]](/icons/layout.gif) | SMB32 Инструкция пользователя.pdf | 2020-12-28 13:58 | 329K | |
![[ ]](/icons/layout.gif) | SMB128 Инструкция пользователя.pdf | 2020-12-28 13:58 | 413K | |
![[ ]](/icons/layout.gif) | SMG4004-4008_CarpeStar_техническое_описание.pdf | 2019-06-05 13:14 | 474K | |
![[ ]](/icons/layout.gif) | SMG4016-4032_CarpeStar_техническое_описание.pdf | 2019-06-05 13:14 | 606K | |
![[ ]](/icons/layout.gif) | SN50-XN-0727.pdf | 2023-09-07 22:01 | 546K | |
![[ ]](/icons/layout.gif) | SPH-1.5÷6-17 (1.5-6 GHZ).pdf | 2023-06-22 12:28 | 945K | |
![[ ]](/icons/layout.gif) | SWG-30XX-1S_Datasheet_.pdf | 2022-12-17 17:51 | 504K | |
![[ ]](/icons/layout.gif) | SWG-30XX-4S_Datasheet.pdf | 2022-12-17 18:41 | 600K | |
![[ ]](/icons/layout.gif) | SWG-3008_Datasheet.pdf | 2022-10-06 16:19 | 881K | |
![[ ]](/icons/layout.gif) | SWG_2008_инструкция_пользователя.pdf | 2019-07-04 13:06 | 2.8M | |
![[ ]](/icons/layout.gif) | SWG_2008_техническое_описание.pdf | 2019-07-04 13:06 | 1.0M | |
![[ ]](/icons/layout.gif) | SWG_M20X_Инструкция_пользователя.pdf | 2020-02-06 21:30 | 2.7M | |
![[ ]](/icons/layout.gif) | SWG_M20X_технические_характеристики.pdf | 2020-02-06 21:28 | 480K | |
![[ ]](/icons/layout.gif) | SX20_1800-2000_PicoCell_инструкция.pdf | 2019-08-06 18:19 | 421K | |
![[ ]](/icons/layout.gif) | SZ-400-NMK datasheet.pdf | 2022-11-26 20:58 | 133K | |
![[ ]](/icons/layout.gif) | S_Series_Yeastar_техническое_описание.pdf | 2019-06-14 00:55 | 454K | |
![[ ]](/icons/layout.gif) | S_Series__Yeastar_инструкция_пользователя.pdf | 2019-06-14 00:55 | 934K | |
![[ ]](/icons/layout.gif) | Selteq-RG8U-TZC-500-32-Specs.pdf | 2023-01-23 20:25 | 535K | |
![[ ]](/icons/layout.gif) | Selteq-SLL-400-SF-Specs.pdf | 2023-05-23 22:26 | 94K | |
![[ ]](/icons/layout.gif) | Selteq-SLL-400-Specs.pdf | 2023-01-23 20:04 | 119K | |
![[ ]](/icons/layout.gif) | Simbank_OpenVox_инструкция_пользователя.pdf | 2019-06-07 17:55 | 2.3M | |
![[ ]](/icons/layout.gif) | Simbank_OpenVox_техническое_описание.pdf | 2019-06-07 17:55 | 1.6M | |
![[ ]](/icons/layout.gif) | Surface-mounting-kit-088-00281-v1.3_техническое_описание.pdf | 2020-05-20 22:56 | 494K | |
![[ ]](/icons/layout.gif) | Synway_UC200_datasheet.pdf | 2022-09-25 13:36 | 367K | |
![[ ]](/icons/layout.gif) | TELEGÄRTNER - LOW LOSS 400 FLEX - 50 OHM COAXIAL CABLE - MMDDYY-TTTT *****M.pdf | 2023-06-21 00:02 | 60K | |
![[ ]](/icons/layout.gif) | TG серия инструкция по установке.pdf | 2019-04-11 12:24 | 2.0M | |
![[ ]](/icons/layout.gif) | TG серия краткое руководство пользователя.pdf | 2019-04-11 12:24 | 1.8M | |
![[ ]](/icons/layout.gif) | TG серия техническое описание.pdf | 2019-04-11 12:24 | 1.3M | |
![[ ]](/icons/layout.gif) | TG21 iRZ справочник IT команд.pdf | 2019-03-20 17:35 | 4.4M | |
![[ ]](/icons/layout.gif) | TG51A_техническое_описание.pdf | 2019-08-25 01:51 | 1.6M | |
![[ ]](/icons/layout.gif) | TG51_техническое_описание.pdf | 2019-08-25 01:25 | 1.6M | |
![[ ]](/icons/layout.gif) | TG52A_техническое_описание.pdf | 2019-09-15 00:35 | 1.6M | |
![[ ]](/icons/layout.gif) | TG52_техническое_описание.pdf | 2019-09-15 00:34 | 1.6M | |
![[ ]](/icons/layout.gif) | TPC-1250H_datasheet.pdf | 2022-10-08 13:06 | 311K | |
![[ ]](/icons/layout.gif) | TRB140-v1.2 техническое описание.pdf | 2019-03-28 15:50 | 914K | |
![[ ]](/icons/layout.gif) | TRB140-v1.4_Техническое_описание.pdf | 2020-02-25 17:13 | 3.1M | |
![[ ]](/icons/layout.gif) | TRB140_Быстрый_старт.pdf | 2020-02-25 17:13 | 1.2M | |
![[ ]](/icons/layout.gif) | TRB140_v2.0 быстрый старт.pdf | 2019-03-28 15:50 | 8.4M | |
![[ ]](/icons/layout.gif) | TRB142-v1.2 техническое описание.pdf | 2019-03-28 16:30 | 894K | |
![[ ]](/icons/layout.gif) | TRB142_v2.0 быстрый старт.pdf | 2019-03-28 16:30 | 5.3M | |
![[ ]](/icons/layout.gif) | TRB245_Datasheet-v1.0.pdf | 2022-10-19 14:09 | 1.2M | |
![[ ]](/icons/layout.gif) | TRB255_Datasheet-v1.0.pdf | 2022-10-19 14:10 | 1.3M | |
![[ ]](/icons/layout.gif) | TRM240_Инструкция_пользователя.pdf | 2020-01-11 14:49 | 1.2M | |
![[ ]](/icons/layout.gif) | TRM240_Техническое_описание.pdf | 2020-01-11 14:48 | 1.3M | |
![[ ]](/icons/layout.gif) | TRM250_инструкция_пользователя.pdf | 2020-01-13 19:57 | 1.1M | |
![[ ]](/icons/layout.gif) | TRM250_техническое_описание.pdf | 2020-01-13 19:02 | 1.3M | |
![[ ]](/icons/layout.gif) | TSW100_Инструкция_пользователя.pdf | 2020-06-23 11:32 | 228K | |
![[ ]](/icons/layout.gif) | TSW100_Техническое_описание.pdf | 2020-06-23 11:32 | 829K | |
![[ ]](/icons/layout.gif) | TSW110_Datasheet-v1.0.pdf | 2022-10-18 13:24 | 910K | |
![[ ]](/icons/layout.gif) | TSW110_EN_v1.1_QSG.pdf | 2022-10-18 13:24 | 233K | |
![[ ]](/icons/compressed.gif) | TU41 iRZ исходники Java-программы.zip | 2019-03-20 17:05 | 6.7K | |
![[ ]](/icons/layout.gif) | TU41 iRZ руководство пользователя.pdf | 2019-03-20 16:48 | 630K | |
![[ ]](/icons/layout.gif) | TU41 iRZ справочник IT команд.pdf | 2019-03-20 16:53 | 2.0M | |
![[ ]](/icons/layout.gif) | TU41 iRZ температурные испытания.pdf | 2019-03-20 16:48 | 137K | |
![[ ]](/icons/layout.gif) | TU41 iRZ техническая документация.pdf | 2019-03-20 16:48 | 665K | |
![[ ]](/icons/compressed.gif) | TU41 iRZ Java-программа.zip | 2019-03-20 17:05 | 50K | |
![[ ]](/icons/compressed.gif) | TU41 iRZ USB драйвер.zip | 2019-03-20 16:48 | 13K | |
![[ ]](/icons/layout.gif) | TZC_500_32_Datasheet.pdf | 2023-05-10 19:02 | 52K | |
![[ ]](/icons/layout.gif) | Tektronix-Y400.pdf | 2024-03-09 00:44 | 461K | |
![[ ]](/icons/layout.gif) | Telegartner_J01020G0141.pdf | 2023-12-05 23:00 | 83K | |
![[ ]](/icons/layout.gif) | Testline_EN_T00013A0248.pdf | 2024-04-07 00:08 | 7.1M | |
![[ ]](/icons/compressed.gif) | U-boot_mod_tlt_rut200_3.1.0_webui Firmware.bin.zip | 2019-04-02 12:47 | 68K | |
![[ ]](/icons/layout.gif) | UAP-AC-IW, UAP-AC-IW-PRO, UAP-AC-LITE, UAP-AC-LR, UAP-AC-PRO, UAP-AC-EDU техническое описание.pdf | 2019-04-20 15:43 | 9.2M | |
![[ ]](/icons/layout.gif) | UAP-IW, UAP, UAP-LR, UAP-PRO, UAP-Outdoor+, UAP-Outdoor5 техническое описание.pdf | 2019-04-20 16:35 | 4.9M | |
![[ ]](/icons/layout.gif) | UAP-nanoHD_QSG_Быстрый_старт.pdf | 2019-05-31 20:10 | 5.2M | |
![[ ]](/icons/layout.gif) | UC100X техническое описание.pdf | 2019-04-11 13:57 | 353K | |
![[ ]](/icons/layout.gif) | UC200 CarpeStar техническое описание.pdf | 2019-03-27 12:03 | 1.2M | |
![[ ]](/icons/layout.gif) | UC500 Техническое описание.pdf | 2019-05-20 18:12 | 1.0M | |
![[ ]](/icons/layout.gif) | UC2000 инструкция пользователя.pdf | 2019-04-11 14:33 | 4.3M | |
![[ ]](/icons/layout.gif) | UC2000-VE:F:G_Техническое_описание_и_инструкция_пользователя.pdf | 2020-12-01 12:20 | 4.3M | |
![[ ]](/icons/layout.gif) | UC2000 VE техническое описание.pdf | 2019-04-11 15:14 | 374K | |
![[ ]](/icons/layout.gif) | UCK-G2 быстрый старт.pdf | 2019-04-21 01:02 | 4.8M | |
![[ ]](/icons/layout.gif) | UCK-G2-PLUS быстрый старт.pdf | 2019-04-21 00:41 | 15M | |
![[ ]](/icons/layout.gif) | UCM62XX инструкция пользователя.pdf | 2019-04-12 20:22 | 15M | |
![[ ]](/icons/layout.gif) | UCM62XX техническое описание.pdf | 2019-04-12 20:22 | 533K | |
![[ ]](/icons/layout.gif) | UCM6202 быстрый старт.pdf | 2019-04-12 20:22 | 3.7M | |
![[ ]](/icons/layout.gif) | UCM6204 быстрый старт.pdf | 2019-04-12 20:25 | 3.8M | |
![[ ]](/icons/layout.gif) | UCM6300_Техническое_описание.pdf | 2020-12-03 19:11 | 651K | |
![[ ]](/icons/layout.gif) | UCM6300_Audio_Series_Datasheet.pdf | 2022-10-06 17:02 | 601K | |
![[ ]](/icons/layout.gif) | UHF-03B-TGN.pdf | 2024-08-03 19:52 | 162K | |
![[ ]](/icons/layout.gif) | UHF-03T-TGN.pdf | 2024-08-03 20:07 | 160K | |
![[ ]](/icons/layout.gif) | UHF-16-3-TGN.pdf | 2024-08-03 19:37 | 144K | |
![[ ]](/icons/layout.gif) | UMG_CarpeStar_инструкция_пользователя.pdf | 2019-06-07 16:07 | 4.2M | |
![[ ]](/icons/layout.gif) | UNO-2473G_datasheet.pdf | 2022-10-06 23:46 | 859K | |
![[ ]](/icons/layout.gif) | UNO-2484G_datasheet.pdf | 2022-10-07 00:06 | 1.1M | |
![[ ]](/icons/layout.gif) | UR32S-L04EU-P-Datasheet-en.pdf | 2023-01-25 13:31 | 718K | |
![[ ]](/icons/layout.gif) | UVC-G3 быстрый старт.pdf | 2019-04-20 18:42 | 5.1M | |
![[ ]](/icons/layout.gif) | UVC-G3 техническое описание.pdf | 2019-04-20 18:42 | 11M | |
![[ ]](/icons/layout.gif) | UVC-G3-DOME быстрый старт.pdf | 2019-04-20 19:07 | 7.3M | |
![[ ]](/icons/layout.gif) | UVC-G3-DOME техническое описание.pdf | 2019-04-20 19:07 | 11M | |
![[ ]](/icons/layout.gif) | UVC-G3-LED быстрый старт.pdf | 2019-04-20 21:52 | 1.8M | |
![[ ]](/icons/layout.gif) | UVC-G3-Micro быстрый старт.pdf | 2019-04-20 21:27 | 7.4M | |
![[ ]](/icons/layout.gif) | UVC-G3-PRO быстрый старт.pdf | 2019-04-20 22:10 | 5.8M | |
![[ ]](/icons/layout.gif) | UVC-G3_Flex быстрый старт.pdf | 2019-04-20 23:21 | 9.2M | |
![[ ]](/icons/layout.gif) | UVC-G4-PRO быстрый старт.pdf | 2019-04-20 22:46 | 5.8M | |
![[ ]](/icons/layout.gif) | UVC-G4-PRO техническое описание.pdf | 2019-04-20 22:46 | 4.3M | |
![[ ]](/icons/layout.gif) | UVC-NVR быстрый старт.pdf | 2019-04-20 19:51 | 2.3M | |
![[ ]](/icons/layout.gif) | UniFI_Video_DS техническое описание.pdf | 2019-04-20 19:51 | 7.8M | |
![[ ]](/icons/layout.gif) | UniFi_nanoHD_AP_Техническое_описание.pdf | 2019-05-31 20:10 | 6.3M | |
![[ ]](/icons/layout.gif) | Uniway2000_CarpeStar_техническое_описание.pdf | 2019-06-05 13:22 | 627K | |
![[ ]](/icons/layout.gif) | Uniway2100_CarpeStar_техническое_описание.pdf | 2019-06-05 13:22 | 6.1M | |
![[ ]](/icons/layout.gif) | VP530 инструкция пользователя.pdf | 2019-04-12 19:02 | 277K | |
![[ ]](/icons/layout.gif) | VP530 инструкция по установке.pdf | 2019-04-12 19:02 | 945K | |
![[ ]](/icons/layout.gif) | VS-GWM420_техническое_описание.pdf | 2019-08-14 23:14 | 1.3M | |
![[ ]](/icons/layout.gif) | VoIPBOX техническое описание.pdf | 2019-04-11 16:23 | 222K | |
![[ ]](/icons/layout.gif) | VoxStack_Series_Gataway_User_Manual_.pdf | 2022-12-21 11:21 | 4.9M | |
![[ ]](/icons/layout.gif) | VoxStack_Series_Wireless_Gateway_Datasheet_.pdf | 2022-12-21 11:21 | 886K | |
![[ ]](/icons/layout.gif) | W52P инструкция пользователя.pdf | 2019-04-12 18:01 | 1.4M | |
![[ ]](/icons/layout.gif) | W52P техническое описание.pdf | 2019-04-12 18:52 | 1.4M | |
![[ ]](/icons/layout.gif) | W56H техническое описание.pdf | 2019-04-15 10:41 | 332K | |
![[ ]](/icons/layout.gif) | W60P техническое описание.pdf | 2019-04-15 15:26 | 431K | |
![[ ]](/icons/layout.gif) | WL-FA003-datasheet.pdf | 2022-11-19 21:09 | 624K | |
![[ ]](/icons/layout.gif) | WL-G510 ROUTER USER MANUAL V1.0.pdf | 2022-11-17 17:36 | 3.6M | |
![[ ]](/icons/layout.gif) | WL-G520-Datasheet.pdf | 2022-11-19 21:28 | 3.0M | |
![[ ]](/icons/layout.gif) | WL-G920 OpenWrt Router Datasheet-Draft.pdf | 2023-01-06 13:38 | 535K | |
![[ ]](/icons/layout.gif) | WL-R210 Series Router User Manual.pdf | 2022-11-09 21:27 | 5.0M | |
![[ ]](/icons/layout.gif) | WL-RT600 User Manual_202003_V1.2.pdf | 2022-11-26 00:09 | 1.5M | |
![[ ]](/icons/layout.gif) | WLINK D80 Series MODEM USER MANUAL_202202_V2.3.pdf | 2022-11-26 00:14 | 1.1M | |
![[ ]](/icons/layout.gif) | WLINK M2M Managment Platform 3.0.pdf | 2022-11-19 23:27 | 2.3M | |
![[ ]](/icons/layout.gif) | WLINK R320 4G Router.pdf | 2023-02-27 14:17 | 8.3M | |
![[ ]](/icons/layout.gif) | WLINK WL-G200-Datasheet.pdf | 2022-12-15 23:05 | 3.7M | |
![[ ]](/icons/layout.gif) | WP820 быстрый старт.pdf | 2019-04-16 10:34 | 6.3M | |
![[ ]](/icons/layout.gif) | WP820 техническое описание.pdf | 2019-04-16 10:34 | 1.5M | |
![[ ]](/icons/layout.gif) | Wlink_WL-R210_datasheet.pdf | 2022-11-09 21:25 | 1.3M | |
![[ ]](/icons/layout.gif) | XQY-PS2-0.5:6-SI.pdf | 2025-03-11 00:43 | 547K | |
![[ ]](/icons/layout.gif) | ZUT26-NJ-NJ-1M .pdf | 2025-05-07 00:45 | 121K | |
![[ ]](/icons/layout.gif) | ZUT26-NJ-Nk-1M .pdf | 2025-05-07 00:56 | 121K | |
![[ ]](/icons/layout.gif) | ZUT26-SMAJ-SMAJ-1M .pdf | 2025-05-07 00:29 | 147K | |
![[ ]](/icons/layout.gif) | ZUT26-SMAJ-SMAK-1M.pdf | 2025-05-06 23:32 | 121K | |
![[ ]](/icons/layout.gif) | ZUT26-cable-specification.pdf | 2025-05-06 23:35 | 234K | |
![[ ]](/icons/layout.gif) | am103&am103l-datasheet-en.pdf | 2023-01-24 23:07 | 254K | |
![[ ]](/icons/layout.gif) | am103&am103l-user-guide-en.pdf | 2023-01-24 23:08 | 889K | |
![[ ]](/icons/layout.gif) | am300-series-datasheet-en.pdf | 2023-01-25 23:13 | 232K | |
![[ ]](/icons/layout.gif) | am300-series-user-guide-en.pdf | 2023-01-25 23:13 | 1.2M | |
![[ ]](/icons/layout.gif) | antenna_hp_patch_brief.pdf | 2023-04-20 12:44 | 2.3M | |
![[ ]](/icons/layout.gif) | antenna_hp_whip_brief.pdf | 2023-04-20 12:52 | 1.3M | |
![[ ]](/icons/layout.gif) | assembly instruction J01010A0049.pdf | 2023-07-15 00:02 | 77K | |
![[IMG]](/icons/image2.gif) | bl-23rp_техническое описаниеjpg.jpg | 2019-08-29 17:28 | 416K | |
![[ ]](/icons/layout.gif) | cAP_Series_быстрый_старт.pdf | 2019-06-14 22:12 | 148K | |
![[ ]](/icons/layout.gif) | cAP_ac_брошюра.pdf | 2019-06-14 22:12 | 1.5M | |
![[ ]](/icons/layout.gif) | data-sheet-rigexpert©-aa-3000-zoom.pdf | 2023-10-24 23:55 | 227K | |
![[ ]](/icons/layout.gif) | devicehub-installation-guide-en.pdf | 2022-11-20 21:00 | 797K | |
![[ ]](/icons/layout.gif) | devicehub-user-guide-en.pdf | 2022-11-20 21:00 | 1.7M | |
![[ ]](/icons/layout.gif) | ds3604-datasheet-en.pdf | 2023-03-10 23:29 | 284K | |
![[ ]](/icons/layout.gif) | ds3604-user-guide-en.pdf | 2023-03-10 23:29 | 1.0M | |
![[ ]](/icons/layout.gif) | ds7610-datasheet-en.pdf | 2022-12-16 00:33 | 728K | |
![[ ]](/icons/layout.gif) | ds7610-user-guide-en.pdf | 2023-03-10 23:30 | 1.3M | |
![[ ]](/icons/layout.gif) | em310-tilt-datasheet-en.pdf | 2023-01-30 23:29 | 219K | |
![[ ]](/icons/layout.gif) | em310-tilt-user-guide-en.pdf | 2023-01-30 23:29 | 1.0M | |
![[ ]](/icons/layout.gif) | em310-udl-datasheet-en.pdf | 2023-01-30 22:58 | 194K | |
![[ ]](/icons/layout.gif) | em310-udl-user-guide-en.pdf | 2023-01-30 22:58 | 754K | |
![[ ]](/icons/layout.gif) | em500-co2-datasheet-en.pdf | 2022-11-21 22:41 | 209K | |
![[ ]](/icons/layout.gif) | em500-lgt-datasheet-en.pdf | 2022-11-22 00:25 | 218K | |
![[ ]](/icons/layout.gif) | em500-pp-datasheet-en.pdf | 2022-11-22 00:45 | 221K | |
![[ ]](/icons/layout.gif) | em500-pt100-datasheet-en.pdf | 2022-11-22 00:00 | 221K | |
![[ ]](/icons/layout.gif) | em500-series-user-guide-en.pdf | 2022-11-21 22:43 | 2.0M | |
![[ ]](/icons/layout.gif) | em500-smtc-datasheet-en.pdf | 2022-11-22 01:03 | 221K | |
![[ ]](/icons/layout.gif) | em500-swl-datasheet-en.pdf | 2022-11-21 23:48 | 321K | |
![[ ]](/icons/layout.gif) | em500-udl-datasheet-en.pdf | 2022-11-21 23:11 | 523K | |
![[ ]](/icons/layout.gif) | gs101-datasheet-en.pdf | 2022-11-21 22:09 | 222K | |
![[ ]](/icons/layout.gif) | gs101-user-guide-en.pdf | 2022-11-21 22:09 | 1.0M | |
![[ ]](/icons/layout.gif) | gwn7602_datasheet_english.pdf | 2023-01-12 20:59 | 851K | |
![[ ]](/icons/layout.gif) | gxw42xx_datasheet.pdf | 2022-10-06 16:38 | 740K | |
![[ ]](/icons/layout.gif) | hAP-lite_инструкция_пользователя.pdf | 2019-06-14 23:51 | 148K | |
![[ ]](/icons/layout.gif) | hengxin-NM-12L-datasheet.pdf | 2023-06-25 15:46 | 519K | |
![[ ]](/icons/layout.gif) | hiboost-micro-strip-splitter.pdf | 2023-02-09 22:02 | 377K | |
![[ ]](/icons/layout.gif) | hyperflex-5-full-datasheet-eng.pdf | 2023-05-19 11:03 | 547K | |
![[IMG]](/icons/image2.gif) | iBox Kit - IAQ Solution Application Topology .jpg | 2022-11-13 22:34 | 94K | |
![[ ]](/icons/layout.gif) | iCallDroid инструкция пользователя.pdf | 2019-04-12 19:42 | 2.5M | |
![[ ]](/icons/layout.gif) | iRZ Настройка туннелей на роутерах.pdf | 2019-04-23 13:41 | 1.7M | |
![[ ]](/icons/layout.gif) | iRZ Средства управления и мониторинга на роутерах.pdf | 2019-04-23 13:41 | 2.1M | |
![[ ]](/icons/layout.gif) | iRZ TG21 температырные испытания.pdf | 2019-03-20 17:23 | 117K | |
![[ ]](/icons/layout.gif) | iRZ TG21.А : iRZ TG21.B инструкция по подключению блока питания.pdf | 2019-03-20 17:23 | 791K | |
![[ ]](/icons/layout.gif) | iRZ TG21.А : iRZ TG21.B монтажный чертеж.pdf | 2019-03-20 17:23 | 138K | |
![[ ]](/icons/layout.gif) | iRZ TG21.А : iRZ TG21.B руководство по эксплуатации.pdf | 2019-03-20 17:23 | 1.1M | |
![[ ]](/icons/layout.gif) | iRZ TG21.А : iRZ TG21.B техническое описание.pdf | 2019-03-20 17:23 | 1.5M | |
![[ ]](/icons/layout.gif) | iRZ_Collector._Настройка_шаг_за_шагом.pdf | 2019-09-12 10:24 | 259K | |
![[ ]](/icons/layout.gif) | iRZ_Collector._Обзор_решения.pdf | 2019-09-12 10:21 | 657K | |
![[ ]](/icons/layout.gif) | iRZ_Collector._Руководство_по_настройке_и_эксплуатации_диспетчерского_ПО.pdf | 2019-09-12 10:21 | 1.5M | |
![[ ]](/icons/layout.gif) | iRZ_Collector._Руководство_по_настройке_серверного_ПО.pdf | 2019-09-12 10:24 | 1.1M | |
![[ ]](/icons/layout.gif) | ibox-cowork-kit-datasheet.pdf | 2022-11-20 19:19 | 796K | |
![[IMG]](/icons/image2.gif) | ibox-cowork-kit-package.png | 2022-11-20 19:18 | 120K | |
![[ ]](/icons/layout.gif) | ibox-cowork-kit-quick-start-guide.pdf | 2022-11-20 19:19 | 18M | |
![[ ]](/icons/layout.gif) | ibox-iaq-kit-datasheet.pdf | 2022-11-13 22:02 | 853K | |
![[ ]](/icons/layout.gif) | ibox-iaq-kit-quick-start-guide.pdf | 2022-11-13 22:37 | 20M | |
![[ ]](/icons/layout.gif) | ibox-kit-collection-overview.pdf | 2022-11-13 22:37 | 17M | |
![[ ]](/icons/layout.gif) | ibox-kit-mielsight-iot-cloud-guide.pdf | 2022-11-13 22:37 | 3.1M | |
![[ ]](/icons/layout.gif) | ibox-smart-building-kit-datasheet.pdf | 2022-11-20 19:58 | 1.2M | |
![[ ]](/icons/layout.gif) | ibox-smart-building-kit-quick-start-guide.pdf | 2022-11-20 19:58 | 13M | |
![[ ]](/icons/unknown.gif) | irz_collector_cm.rar | 2019-03-20 17:31 | 38M | |
![[ ]](/icons/layout.gif) | kathrein_360_80010137_техническое_описание.pdf | 2019-06-20 15:09 | 29K | |
![[ ]](/icons/layout.gif) | kathrein_80010465.pdf | 2023-02-25 22:52 | 106K | |
![[IMG]](/icons/image2.gif) | kingsignal-rg-213.jpg | 2023-05-10 18:38 | 211K | |
![[ ]](/icons/layout.gif) | kingsignal-rg-213.pdf | 2023-05-10 18:39 | 213K | |
![[ ]](/icons/layout.gif) | lorawan-agricultural-kit-datasheet-en.pdf | 2023-01-31 21:58 | 1.0M | |
![[ ]](/icons/layout.gif) | mANT_LTE_5o_180421.pdf | 2023-03-18 23:20 | 273K | |
![[ ]](/icons/layout.gif) | milesight-indoor-air-quality-solution-brochure.pdf | 2022-11-26 20:08 | 5.7M | |
![[ ]](/icons/layout.gif) | milesight-iot-cloud-ebook.pdf | 2022-11-20 21:06 | 14M | |
![[ ]](/icons/layout.gif) | milesightvpn-user-guide-en.pdf | 2023-01-24 21:37 | 1.5M | |
![[ ]](/icons/layout.gif) | rut906-datasheet-2023-v12.pdf | 2023-11-12 14:01 | 1.5M | |
![[ ]](/icons/layout.gif) | rut906-flyer-2023-v12.pdf | 2023-11-12 14:01 | 1.2M | |
![[ ]](/icons/layout.gif) | rut956-datasheet-2023-v12.pdf | 2024-03-01 13:26 | 1.5M | |
![[ ]](/icons/unknown.gif) | scriptloader.rar | 2019-03-20 17:31 | 3.1M | |
![[ ]](/icons/layout.gif) | selteq-sll-240-sf-specs.pdf | 2023-07-14 18:16 | 95K | |
![[ ]](/icons/layout.gif) | selteq-sll-400-sfp-specs.pdf | 2024-10-09 00:44 | 94K | |
![[ ]](/icons/layout.gif) | sll-400-TCCAA.pdf | 2025-09-12 14:21 | 162K | |
![[ ]](/icons/layout.gif) | tinySA-TinySA4-Specification-Datasheet.pdf | 2023-12-19 21:54 | 91K | |
![[ ]](/icons/layout.gif) | tinySA | TinySA4 - Specification-Datasheet.pdf | 2023-12-19 21:53 | 91K | |
![[ ]](/icons/layout.gif) | tinySA | TinySA4 : Specification-Datasheet.pdf | 2023-12-19 21:51 | 91K | |
![[ ]](/icons/layout.gif) | uc50x-series-datasheet-en.pdf | 2022-11-22 20:10 | 196K | |
![[ ]](/icons/layout.gif) | uc50x-series-user-guide-en.pdf | 2022-11-22 20:11 | 1.9M | |
![[ ]](/icons/layout.gif) | uc51x-series-datasheet-en.pdf | 2022-11-22 20:29 | 346K | |
![[ ]](/icons/layout.gif) | uc51x-series-user-guide-en.pdf | 2022-11-22 20:30 | 2.0M | |
![[ ]](/icons/layout.gif) | uc300-datasheet-en.pdf | 2023-03-06 20:13 | 322K | |
![[ ]](/icons/layout.gif) | uc300-user-guide-en.pdf | 2023-03-06 20:13 | 1.4M | |
![[ ]](/icons/layout.gif) | uf51-datasheet-en.pdf | 2023-02-03 23:26 | 391K | |
![[ ]](/icons/layout.gif) | uf51-user-guide-en.pdf | 2023-02-03 23:26 | 6.9M | |
![[ ]](/icons/layout.gif) | ug56-datasheet-en.pdf | 2022-11-12 16:57 | 378K | |
![[ ]](/icons/layout.gif) | ug56-user-guide-en.pdf | 2022-11-12 16:58 | 4.7M | |
![[ ]](/icons/layout.gif) | ug63-datasheet-en.pdf | 2022-11-13 01:27 | 379K | |
![[ ]](/icons/layout.gif) | ug63-user-guide-en.pdf | 2022-11-13 01:27 | 3.5M | |
![[ ]](/icons/layout.gif) | ug65-datasheet-en.pdf | 2022-11-12 00:53 | 385K | |
![[ ]](/icons/layout.gif) | ug65-helium-hotspot-datasheet.pdf | 2022-11-12 00:13 | 313K | |
![[ ]](/icons/layout.gif) | ug65-user-guide-en.pdf | 2022-11-12 00:53 | 5.1M | |
![[ ]](/icons/layout.gif) | ug67-datasheet-en.pdf | 2022-11-12 16:01 | 481K | |
![[ ]](/icons/layout.gif) | ug67-user-guide-en.pdf | 2022-11-12 16:01 | 4.9M | |
![[ ]](/icons/layout.gif) | ur32-datasheet-en.pdf | 2022-11-07 14:53 | 541K | |
![[ ]](/icons/layout.gif) | ur32-user-guide-en.pdf | 2022-11-07 15:42 | 6.9M | |
![[ ]](/icons/layout.gif) | ur32l-datasheet-en.pdf | 2022-11-12 23:34 | 506K | |
![[ ]](/icons/layout.gif) | ur32l-user-guide-en.pdf | 2022-11-12 23:34 | 5.0M | |
![[ ]](/icons/layout.gif) | ur35-datasheet-en.pdf | 2022-11-07 16:50 | 457K | |
![[ ]](/icons/layout.gif) | ur35-user-guide-en.pdf | 2022-11-07 16:50 | 6.3M | |
![[ ]](/icons/layout.gif) | ur41-datasheet-en.pdf | 2023-02-14 13:28 | 481K | |
![[ ]](/icons/layout.gif) | ur75-datasheet-en.pdf | 2022-11-13 00:51 | 495K | |
![[ ]](/icons/layout.gif) | ur75-user-guide-en.pdf | 2022-11-13 00:50 | 6.3M | |
![[ ]](/icons/layout.gif) | usermanual-aa-3000zoom_english.pdf | 2023-10-24 23:55 | 4.2M | |
![[ ]](/icons/layout.gif) | vs121-datasheet-en.pdf | 2023-03-12 22:33 | 184K | |
![[ ]](/icons/layout.gif) | vs121-user-guide-en.pdf | 2023-03-12 22:34 | 1.3M | |
![[ ]](/icons/layout.gif) | wAP-series_инструкция_пользователя.pdf | 2019-06-14 22:16 | 113K | |
![[ ]](/icons/layout.gif) | wAP_техническое_описание.pdf | 2019-06-14 22:16 | 1.4M | |
![[ ]](/icons/layout.gif) | wifi-dual-band-sma-antenna-pr14rd35.pdf | 2023-07-05 18:39 | 187K | |
![[ ]](/icons/layout.gif) | ws52x-datasheet-en.pdf | 2022-12-15 01:21 | 209K | |
![[ ]](/icons/layout.gif) | ws52x-user-guide-en.pdf | 2022-12-15 01:35 | 775K | |
![[ ]](/icons/layout.gif) | ws101-datasheet-en.pdf | 2023-03-07 13:40 | 183K | |
![[ ]](/icons/layout.gif) | ws101-user-guide-en.pdf | 2023-03-07 13:40 | 702K | |
![[ ]](/icons/layout.gif) | ws136&ws156-datasheet-en.pdf | 2023-03-07 15:44 | 185K | |
![[ ]](/icons/layout.gif) | ws136&ws156-user-guide-en.pdf | 2023-03-07 15:44 | 774K | |
![[ ]](/icons/layout.gif) | wts-series-datasheet-en.pdf | 2022-11-22 01:53 | 315K | |
![[ ]](/icons/layout.gif) | wts-series-user-guide-en.pdf | 2022-11-22 01:53 | 1.3M | |
|